About 12H-thiochromeno[2,3-b]acridine-7,14-dione
12H-thiochromeno[2,3-b]acridine-7,14-dione (PubChem CID 67634698) has the molecular formula C20H11NO2S
and a molecular weight of 329.38 g/mol. Its IUPAC name is 12H-thiochromeno[2,3-b]acridine-7,14-dione.
Molecular Properties
| Compound Name | 12H-thiochromeno[2,3-b]acridine-7,14-dione |
| PubChem CID | 67634698 |
| Molecular Formula | C20H11NO2S |
| Molecular Weight | 329.38 g/mol |
| Exact Mass | 329.05 |
| IUPAC Name | 12H-thiochromeno[2,3-b]acridine-7,14-dione |
| SMILES | O=c1c2ccccc2[nH]c2cc3c(=O)c4ccccc4sc3cc12 |
| InChI | InChI=1S/C20H11NO2S/c22-19-11-5-1-3-7-15(11)21-16-9-14-18(10-13(16)19)24-17-8-4-2-6-12(17)20(14)23/h1-10H,(H,21,22) |
| InChIKey | PWKBNJDVPBHTMK-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 49.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.38 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 12H-thiochromeno[2,3-b]acridine-7,14-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 12H-thiochromeno[2,3-b]acridine-7,14-dione?
The IUPAC name of 12H-thiochromeno[2,3-b]acridine-7,14-dione (CID 67634698) is 12H-thiochromeno[2,3-b]acridine-7,14-dione.
What is the SMILES notation for 12H-thiochromeno[2,3-b]acridine-7,14-dione?
The canonical SMILES for 12H-thiochromeno[2,3-b]acridine-7,14-dione is O=c1c2ccccc2[nH]c2cc3c(=O)c4ccccc4sc3cc12.
What is the InChIKey of 12H-thiochromeno[2,3-b]acridine-7,14-dione?
The InChIKey is PWKBNJDVPBHTMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H11NO2S/c22-19-11-5-1-3-7-15(11)21-16-9-14-18(10-13(16)19)24-17-8-4-2-6-12(17)20(14)23/h1-10H,(H,21,22).
What are the key properties of 12H-thiochromeno[2,3-b]acridine-7,14-dione?
12H-thiochromeno[2,3-b]acridine-7,14-dione has a molecular weight of 329.38 g/mol, XLogP of 4.41, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 12H-thiochromeno[2,3-b]acridine-7,14-dione is sourced from PubChem (CID 67634698), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).