C9H11NO3 — CID 67635566
4-methoxy-3a,4,5,7a-tetrahydroisoindole-1,3-dione (PubChem CID 67635566) has the molecular formula C9H11NO3 and a molecular weight of 181.19 g/mol. Its IUPAC name is 4-methoxy-3a,4,5,7a-tetrahydroisoindole-1,3-dione.
| Compound Name | 4-methoxy-3a,4,5,7a-tetrahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 67635566 |
| Molecular Formula | C9H11NO3 |
| Molecular Weight | 181.19 g/mol |
| Exact Mass | 181.07 |
| IUPAC Name | 4-methoxy-3a,4,5,7a-tetrahydroisoindole-1,3-dione |
| SMILES | COC1CC=CC2C(=O)NC(=O)C12 |
| InChI | InChI=1S/C9H11NO3/c1-13-6-4-2-3-5-7(6)9(12)10-8(5)11/h2-3,5-7H,4H2,1H3,(H,10,11,12) |
| InChIKey | GHSMFEYYJSDMSM-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.19 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|