C26H25F2NO4 — CID 67635602
2-(1-benzylpiperidin-4-yl)-3-fluorobenzoic acid;2-fluorobenzoic acid (PubChem CID 67635602) has the molecular formula C26H25F2NO4 and a molecular weight of 453.49 g/mol. Its IUPAC name is 2-(1-benzylpiperidin-4-yl)-3-fluorobenzoic acid;2-fluorobenzoic acid.
| Compound Name | 2-(1-benzylpiperidin-4-yl)-3-fluorobenzoic acid;2-fluorobenzoic acid |
|---|---|
| PubChem CID | 67635602 |
| Molecular Formula | C26H25F2NO4 |
| Molecular Weight | 453.49 g/mol |
| Exact Mass | 453.18 |
| IUPAC Name | 2-(1-benzylpiperidin-4-yl)-3-fluorobenzoic acid;2-fluorobenzoic acid |
| SMILES | O=C(O)c1cccc(F)c1C1CCN(Cc2ccccc2)CC1.O=C(O)c1ccccc1F |
| InChI | InChI=1S/C19H20FNO2.C7H5FO2/c20-17-8-4-7-16(19(22)23)18(17)15-9-11-21(12-10-15)13-14-5-2-1-3-6-14;8-6-4-2-1-3-5(6)7(9)10/h1-8,15H,9-13H2,(H,22,23);1-4H,(H,9,10) |
| InChIKey | QVKISHVEHPKMNT-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.49 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |