About 4-[5-[2-(3,5-dichloro-4-pyridinyl)acetyl]-2-methylsulfanylphenoxy]oxan-2-one
4-[5-[2-(3,5-dichloro-4-pyridinyl)acetyl]-2-methylsulfanylphenoxy]oxan-2-one (PubChem CID 67635915) has the molecular formula C19H17Cl2NO4S
and a molecular weight of 426.32 g/mol. Its IUPAC name is 4-[5-[2-(3,5-dichloro-4-pyridinyl)acetyl]-2-methylsulfanylphenoxy]oxan-2-one.
Molecular Properties
| Compound Name | 4-[5-[2-(3,5-dichloro-4-pyridinyl)acetyl]-2-methylsulfanylphenoxy]oxan-2-one |
| PubChem CID | 67635915 |
| Molecular Formula | C19H17Cl2NO4S |
| Molecular Weight | 426.32 g/mol |
| Exact Mass | 425.03 |
| IUPAC Name | 4-[5-[2-(3,5-dichloro-4-pyridinyl)acetyl]-2-methylsulfanylphenoxy]oxan-2-one |
| SMILES | CSc1ccc(C(=O)Cc2c(Cl)cncc2Cl)cc1OC1CCOC(=O)C1 |
| InChI | InChI=1S/C19H17Cl2NO4S/c1-27-18-3-2-11(6-17(18)26-12-4-5-25-19(24)7-12)16(23)8-13-14(20)9-22-10-15(13)21/h2-3,6,9-10,12H,4-5,7-8H2,1H3 |
| InChIKey | JXVIKVRNZAIISU-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 65.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 426.32 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-[5-[2-(3,5-dichloro-4-pyridinyl)acetyl]-2-methylsulfanylphenoxy]oxan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[5-[2-(3,5-dichloro-4-pyridinyl)acetyl]-2-methylsulfanylphenoxy]oxan-2-one?
The IUPAC name of 4-[5-[2-(3,5-dichloro-4-pyridinyl)acetyl]-2-methylsulfanylphenoxy]oxan-2-one (CID 67635915) is 4-[5-[2-(3,5-dichloro-4-pyridinyl)acetyl]-2-methylsulfanylphenoxy]oxan-2-one.
What is the SMILES notation for 4-[5-[2-(3,5-dichloro-4-pyridinyl)acetyl]-2-methylsulfanylphenoxy]oxan-2-one?
The canonical SMILES for 4-[5-[2-(3,5-dichloro-4-pyridinyl)acetyl]-2-methylsulfanylphenoxy]oxan-2-one is CSc1ccc(C(=O)Cc2c(Cl)cncc2Cl)cc1OC1CCOC(=O)C1.
What is the InChIKey of 4-[5-[2-(3,5-dichloro-4-pyridinyl)acetyl]-2-methylsulfanylphenoxy]oxan-2-one?
The InChIKey is JXVIKVRNZAIISU-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17Cl2NO4S/c1-27-18-3-2-11(6-17(18)26-12-4-5-25-19(24)7-12)16(23)8-13-14(20)9-22-10-15(13)21/h2-3,6,9-10,12H,4-5,7-8H2,1H3.
What are the key properties of 4-[5-[2-(3,5-dichloro-4-pyridinyl)acetyl]-2-methylsulfanylphenoxy]oxan-2-one?
4-[5-[2-(3,5-dichloro-4-pyridinyl)acetyl]-2-methylsulfanylphenoxy]oxan-2-one has a molecular weight of 426.32 g/mol, XLogP of 4.62, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[5-[2-(3,5-dichloro-4-pyridinyl)acetyl]-2-methylsulfanylphenoxy]oxan-2-one is sourced from PubChem (CID 67635915), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).