C32H29Cl2N5O4 — CID 67635930
4-[3-[[1-[3-[2-(1H-benzimidazol-4-yloxy)-2-methoxyethyl]-2,4-dichlorophenyl]pyrrol-2-yl]methylamino]-3-oxoprop-1-enyl]-N-methylbenzamide (PubChem CID 67635930) has the molecular formula C32H29Cl2N5O4 and a molecular weight of 618.52 g/mol. Its IUPAC name is 4-[3-[[1-[3-[2-(1H-benzimidazol-4-yloxy)-2-methoxyethyl]-2,4-dichlorophenyl]pyrrol-2-yl]methylamino]-3-oxoprop-1-enyl]-N-methylbenzamide.
| Compound Name | 4-[3-[[1-[3-[2-(1H-benzimidazol-4-yloxy)-2-methoxyethyl]-2,4-dichlorophenyl]pyrrol-2-yl]methylamino]-3-oxoprop-1-enyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 67635930 |
| Molecular Formula | C32H29Cl2N5O4 |
| Molecular Weight | 618.52 g/mol |
| Exact Mass | 617.16 |
| IUPAC Name | 4-[3-[[1-[3-[2-(1H-benzimidazol-4-yloxy)-2-methoxyethyl]-2,4-dichlorophenyl]pyrrol-2-yl]methylamino]-3-oxoprop-1-enyl]-N-methylbenzamide |
| SMILES | CNC(=O)c1ccc(C=CC(=O)NCc2cccn2-c2ccc(Cl)c(CC(OC)Oc3cccc4[nH]cnc34)c2Cl)cc1 |
| InChI | InChI=1S/C32H29Cl2N5O4/c1-35-32(41)21-11-8-20(9-12-21)10-15-28(40)36-18-22-5-4-16-39(22)26-14-13-24(33)23(30(26)34)17-29(42-2)43-27-7-3-6-25-31(27)38-19-37-25/h3-16,19,29H,17-18H2,1-2H3,(H,35,41)(H,36,40)(H,37,38) |
| InChIKey | DFASHFHMLXAKRT-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 110.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.52 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|