About 2-[2-[2-(3,4-dichlorophenyl)-2-methylpropyl]hydrazinyl]ethanol;dihydrochloride
2-[2-[2-(3,4-dichlorophenyl)-2-methylpropyl]hydrazinyl]ethanol;dihydrochloride (PubChem CID 67636355) has the molecular formula C12H20Cl4N2O
and a molecular weight of 350.12 g/mol. Its IUPAC name is 2-[2-[2-(3,4-dichlorophenyl)-2-methylpropyl]hydrazinyl]ethanol;dihydrochloride.
Molecular Properties
| Compound Name | 2-[2-[2-(3,4-dichlorophenyl)-2-methylpropyl]hydrazinyl]ethanol;dihydrochloride |
| PubChem CID | 67636355 |
| Molecular Formula | C12H20Cl4N2O |
| Molecular Weight | 350.12 g/mol |
| Exact Mass | 348.03 |
| IUPAC Name | 2-[2-[2-(3,4-dichlorophenyl)-2-methylpropyl]hydrazinyl]ethanol;dihydrochloride |
| SMILES | CC(C)(CNNCCO)c1ccc(Cl)c(Cl)c1.Cl.Cl |
| InChI | InChI=1S/C12H18Cl2N2O.2ClH/c1-12(2,8-16-15-5-6-17)9-3-4-10(13)11(14)7-9;;/h3-4,7,15-17H,5-6,8H2,1-2H3;2*1H |
| InChIKey | CNPDCULEJZOIIH-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.12 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-[2-(3,4-dichlorophenyl)-2-methylpropyl]hydrazinyl]ethanol;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-[2-(3,4-dichlorophenyl)-2-methylpropyl]hydrazinyl]ethanol;dihydrochloride?
The IUPAC name of 2-[2-[2-(3,4-dichlorophenyl)-2-methylpropyl]hydrazinyl]ethanol;dihydrochloride (CID 67636355) is 2-[2-[2-(3,4-dichlorophenyl)-2-methylpropyl]hydrazinyl]ethanol;dihydrochloride.
What is the SMILES notation for 2-[2-[2-(3,4-dichlorophenyl)-2-methylpropyl]hydrazinyl]ethanol;dihydrochloride?
The canonical SMILES for 2-[2-[2-(3,4-dichlorophenyl)-2-methylpropyl]hydrazinyl]ethanol;dihydrochloride is CC(C)(CNNCCO)c1ccc(Cl)c(Cl)c1.Cl.Cl.
What is the InChIKey of 2-[2-[2-(3,4-dichlorophenyl)-2-methylpropyl]hydrazinyl]ethanol;dihydrochloride?
The InChIKey is CNPDCULEJZOIIH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18Cl2N2O.2ClH/c1-12(2,8-16-15-5-6-17)9-3-4-10(13)11(14)7-9;;/h3-4,7,15-17H,5-6,8H2,1-2H3;2*1H.
What are the key properties of 2-[2-[2-(3,4-dichlorophenyl)-2-methylpropyl]hydrazinyl]ethanol;dihydrochloride?
2-[2-[2-(3,4-dichlorophenyl)-2-methylpropyl]hydrazinyl]ethanol;dihydrochloride has a molecular weight of 350.12 g/mol, XLogP of 3.20, 6 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-[2-(3,4-dichlorophenyl)-2-methylpropyl]hydrazinyl]ethanol;dihydrochloride is sourced from PubChem (CID 67636355), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).