C26H25FN2O — CID 67636520
2-[5-(6-fluorohept-1-ynyl)-2-(4-prop-2-enoxyphenyl)phenyl]pyrazine (PubChem CID 67636520) has the molecular formula C26H25FN2O and a molecular weight of 400.50 g/mol. Its IUPAC name is 2-[5-(6-fluorohept-1-ynyl)-2-(4-prop-2-enoxyphenyl)phenyl]pyrazine.
| Compound Name | 2-[5-(6-fluorohept-1-ynyl)-2-(4-prop-2-enoxyphenyl)phenyl]pyrazine |
|---|---|
| PubChem CID | 67636520 |
| Molecular Formula | C26H25FN2O |
| Molecular Weight | 400.50 g/mol |
| Exact Mass | 400.20 |
| IUPAC Name | 2-[5-(6-fluorohept-1-ynyl)-2-(4-prop-2-enoxyphenyl)phenyl]pyrazine |
| SMILES | C=CCOc1ccc(-c2ccc(C#CCCCC(C)F)cc2-c2cnccn2)cc1 |
| InChI | InChI=1S/C26H25FN2O/c1-3-17-30-23-12-10-22(11-13-23)24-14-9-21(8-6-4-5-7-20(2)27)18-25(24)26-19-28-15-16-29-26/h3,9-16,18-20H,1,4-5,7,17H2,2H3 |
| InChIKey | ZPWAMDMSERJRMY-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.50 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|