About (2S)-2-but-2-enyl-6-methylspiro[2H-indene-3,1'-cyclohexane]-1-one
(2S)-2-but-2-enyl-6-methylspiro[2H-indene-3,1'-cyclohexane]-1-one (PubChem CID 67636665) has the molecular formula C19H24O
and a molecular weight of 268.40 g/mol. Its IUPAC name is (2S)-2-but-2-enyl-6-methylspiro[2H-indene-3,1'-cyclohexane]-1-one.
Molecular Properties
| Compound Name | (2S)-2-but-2-enyl-6-methylspiro[2H-indene-3,1'-cyclohexane]-1-one |
| PubChem CID | 67636665 |
| Molecular Formula | C19H24O |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.18 |
| IUPAC Name | (2S)-2-but-2-enyl-6-methylspiro[2H-indene-3,1'-cyclohexane]-1-one |
| SMILES | CC=CC[C@@H]1C(=O)c2cc(C)ccc2C12CCCCC2 |
| InChI | InChI=1S/C19H24O/c1-3-4-8-17-18(20)15-13-14(2)9-10-16(15)19(17)11-6-5-7-12-19/h3-4,9-10,13,17H,5-8,11-12H2,1-2H3/t17-/m1/s1 |
| InChIKey | BDWNIKHGIZXPPP-QGZVFWFLSA-N |
| XLogP | 4.98 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2S)-2-but-2-enyl-6-methylspiro[2H-indene-3,1'-cyclohexane]-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-but-2-enyl-6-methylspiro[2H-indene-3,1'-cyclohexane]-1-one?
The IUPAC name of (2S)-2-but-2-enyl-6-methylspiro[2H-indene-3,1'-cyclohexane]-1-one (CID 67636665) is (2S)-2-but-2-enyl-6-methylspiro[2H-indene-3,1'-cyclohexane]-1-one.
What is the SMILES notation for (2S)-2-but-2-enyl-6-methylspiro[2H-indene-3,1'-cyclohexane]-1-one?
The canonical SMILES for (2S)-2-but-2-enyl-6-methylspiro[2H-indene-3,1'-cyclohexane]-1-one is CC=CC[C@@H]1C(=O)c2cc(C)ccc2C12CCCCC2.
What is the InChIKey of (2S)-2-but-2-enyl-6-methylspiro[2H-indene-3,1'-cyclohexane]-1-one?
The InChIKey is BDWNIKHGIZXPPP-QGZVFWFLSA-N. The full InChI is InChI=1S/C19H24O/c1-3-4-8-17-18(20)15-13-14(2)9-10-16(15)19(17)11-6-5-7-12-19/h3-4,9-10,13,17H,5-8,11-12H2,1-2H3/t17-/m1/s1.
What are the key properties of (2S)-2-but-2-enyl-6-methylspiro[2H-indene-3,1'-cyclohexane]-1-one?
(2S)-2-but-2-enyl-6-methylspiro[2H-indene-3,1'-cyclohexane]-1-one has a molecular weight of 268.40 g/mol, XLogP of 4.98, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-but-2-enyl-6-methylspiro[2H-indene-3,1'-cyclohexane]-1-one is sourced from PubChem (CID 67636665), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).