About 4-(4-quinoxalin-2-ylphenoxy)benzene-1,2-dicarbonitrile
4-(4-quinoxalin-2-ylphenoxy)benzene-1,2-dicarbonitrile (PubChem CID 676369) has the molecular formula C22H12N4O
and a molecular weight of 348.37 g/mol. Its IUPAC name is 4-(4-quinoxalin-2-ylphenoxy)benzene-1,2-dicarbonitrile.
Molecular Properties
| Compound Name | 4-(4-quinoxalin-2-ylphenoxy)benzene-1,2-dicarbonitrile |
| PubChem CID | 676369 |
| Molecular Formula | C22H12N4O |
| Molecular Weight | 348.37 g/mol |
| Exact Mass | 348.10 |
| IUPAC Name | 4-(4-quinoxalin-2-ylphenoxy)benzene-1,2-dicarbonitrile |
| SMILES | N#Cc1ccc(Oc2ccc(-c3cnc4ccccc4n3)cc2)cc1C#N |
| InChI | InChI=1S/C22H12N4O/c23-12-16-7-10-19(11-17(16)13-24)27-18-8-5-15(6-9-18)22-14-25-20-3-1-2-4-21(20)26-22/h1-11,14H |
| InChIKey | IAIXMAGERSFZMA-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 82.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.37 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-(4-quinoxalin-2-ylphenoxy)benzene-1,2-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-quinoxalin-2-ylphenoxy)benzene-1,2-dicarbonitrile?
The IUPAC name of 4-(4-quinoxalin-2-ylphenoxy)benzene-1,2-dicarbonitrile (CID 676369) is 4-(4-quinoxalin-2-ylphenoxy)benzene-1,2-dicarbonitrile.
What is the SMILES notation for 4-(4-quinoxalin-2-ylphenoxy)benzene-1,2-dicarbonitrile?
The canonical SMILES for 4-(4-quinoxalin-2-ylphenoxy)benzene-1,2-dicarbonitrile is N#Cc1ccc(Oc2ccc(-c3cnc4ccccc4n3)cc2)cc1C#N.
What is the InChIKey of 4-(4-quinoxalin-2-ylphenoxy)benzene-1,2-dicarbonitrile?
The InChIKey is IAIXMAGERSFZMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H12N4O/c23-12-16-7-10-19(11-17(16)13-24)27-18-8-5-15(6-9-18)22-14-25-20-3-1-2-4-21(20)26-22/h1-11,14H.
What are the key properties of 4-(4-quinoxalin-2-ylphenoxy)benzene-1,2-dicarbonitrile?
4-(4-quinoxalin-2-ylphenoxy)benzene-1,2-dicarbonitrile has a molecular weight of 348.37 g/mol, XLogP of 4.83, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-quinoxalin-2-ylphenoxy)benzene-1,2-dicarbonitrile is sourced from PubChem (CID 676369), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).