About [(5-hydroxy-1,6-dimethyl-3H-pyridin-1-ium-4-ylidene)amino]urea
[(5-hydroxy-1,6-dimethyl-3H-pyridin-1-ium-4-ylidene)amino]urea (PubChem CID 67636903) has the molecular formula C8H13N4O2+
and a molecular weight of 197.22 g/mol. Its IUPAC name is [(5-hydroxy-1,6-dimethyl-3H-pyridin-1-ium-4-ylidene)amino]urea.
Molecular Properties
| Compound Name | [(5-hydroxy-1,6-dimethyl-3H-pyridin-1-ium-4-ylidene)amino]urea |
| PubChem CID | 67636903 |
| Molecular Formula | C8H13N4O2+ |
| Molecular Weight | 197.22 g/mol |
| Exact Mass | 197.10 |
| IUPAC Name | [(5-hydroxy-1,6-dimethyl-3H-pyridin-1-ium-4-ylidene)amino]urea |
| SMILES | CC1=C(O)C(=NNC(N)=O)CC=[N+]1C |
| InChI | InChI=1S/C8H12N4O2/c1-5-7(13)6(3-4-12(5)2)10-11-8(9)14/h4H,3H2,1-2H3,(H3-,9,11,13,14)/p+1 |
| InChIKey | ZQGULJSABLNAEH-UHFFFAOYSA-O |
| XLogP | -0.08 |
| TPSA | 90.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.22 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze [(5-hydroxy-1,6-dimethyl-3H-pyridin-1-ium-4-ylidene)amino]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(5-hydroxy-1,6-dimethyl-3H-pyridin-1-ium-4-ylidene)amino]urea?
The IUPAC name of [(5-hydroxy-1,6-dimethyl-3H-pyridin-1-ium-4-ylidene)amino]urea (CID 67636903) is [(5-hydroxy-1,6-dimethyl-3H-pyridin-1-ium-4-ylidene)amino]urea.
What is the SMILES notation for [(5-hydroxy-1,6-dimethyl-3H-pyridin-1-ium-4-ylidene)amino]urea?
The canonical SMILES for [(5-hydroxy-1,6-dimethyl-3H-pyridin-1-ium-4-ylidene)amino]urea is CC1=C(O)C(=NNC(N)=O)CC=[N+]1C.
What is the InChIKey of [(5-hydroxy-1,6-dimethyl-3H-pyridin-1-ium-4-ylidene)amino]urea?
The InChIKey is ZQGULJSABLNAEH-UHFFFAOYSA-O. The full InChI is InChI=1S/C8H12N4O2/c1-5-7(13)6(3-4-12(5)2)10-11-8(9)14/h4H,3H2,1-2H3,(H3-,9,11,13,14)/p+1.
What are the key properties of [(5-hydroxy-1,6-dimethyl-3H-pyridin-1-ium-4-ylidene)amino]urea?
[(5-hydroxy-1,6-dimethyl-3H-pyridin-1-ium-4-ylidene)amino]urea has a molecular weight of 197.22 g/mol, XLogP of -0.08, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(5-hydroxy-1,6-dimethyl-3H-pyridin-1-ium-4-ylidene)amino]urea is sourced from PubChem (CID 67636903), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).