About 3-amino-2-nitro-N,N-bis(prop-2-enyl)pyridine-4-sulfonamide
3-amino-2-nitro-N,N-bis(prop-2-enyl)pyridine-4-sulfonamide (PubChem CID 67637181) has the molecular formula C11H14N4O4S
and a molecular weight of 298.32 g/mol. Its IUPAC name is 3-amino-2-nitro-N,N-bis(prop-2-enyl)pyridine-4-sulfonamide.
Molecular Properties
| Compound Name | 3-amino-2-nitro-N,N-bis(prop-2-enyl)pyridine-4-sulfonamide |
| PubChem CID | 67637181 |
| Molecular Formula | C11H14N4O4S |
| Molecular Weight | 298.32 g/mol |
| Exact Mass | 298.07 |
| IUPAC Name | 3-amino-2-nitro-N,N-bis(prop-2-enyl)pyridine-4-sulfonamide |
| SMILES | C=CCN(CC=C)S(=O)(=O)c1ccnc([N+](=O)[O-])c1N |
| InChI | InChI=1S/C11H14N4O4S/c1-3-7-14(8-4-2)20(18,19)9-5-6-13-11(10(9)12)15(16)17/h3-6H,1-2,7-8,12H2 |
| InChIKey | ISAQUPGGISECTC-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 119.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.32 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-amino-2-nitro-N,N-bis(prop-2-enyl)pyridine-4-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-2-nitro-N,N-bis(prop-2-enyl)pyridine-4-sulfonamide?
The IUPAC name of 3-amino-2-nitro-N,N-bis(prop-2-enyl)pyridine-4-sulfonamide (CID 67637181) is 3-amino-2-nitro-N,N-bis(prop-2-enyl)pyridine-4-sulfonamide.
What is the SMILES notation for 3-amino-2-nitro-N,N-bis(prop-2-enyl)pyridine-4-sulfonamide?
The canonical SMILES for 3-amino-2-nitro-N,N-bis(prop-2-enyl)pyridine-4-sulfonamide is C=CCN(CC=C)S(=O)(=O)c1ccnc([N+](=O)[O-])c1N.
What is the InChIKey of 3-amino-2-nitro-N,N-bis(prop-2-enyl)pyridine-4-sulfonamide?
The InChIKey is ISAQUPGGISECTC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N4O4S/c1-3-7-14(8-4-2)20(18,19)9-5-6-13-11(10(9)12)15(16)17/h3-6H,1-2,7-8,12H2.
What are the key properties of 3-amino-2-nitro-N,N-bis(prop-2-enyl)pyridine-4-sulfonamide?
3-amino-2-nitro-N,N-bis(prop-2-enyl)pyridine-4-sulfonamide has a molecular weight of 298.32 g/mol, XLogP of 0.93, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-2-nitro-N,N-bis(prop-2-enyl)pyridine-4-sulfonamide is sourced from PubChem (CID 67637181), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).