C27H25ClN2O — CID 67637424
[(1R,8S)-4-chloro-1-tetracyclo[6.6.1.02,7.09,14]pentadeca-2(7),3,5,9,11,13-hexaenyl]-[4-(pyridin-3-ylmethyl)piperidin-1-yl]methanone (PubChem CID 67637424) has the molecular formula C27H25ClN2O and a molecular weight of 428.96 g/mol. Its IUPAC name is [(1R,8S)-4-chloro-1-tetracyclo[6.6.1.02,7.09,14]pentadeca-2(7),3,5,9,11,13-hexaenyl]-[4-(pyridin-3-ylmethyl)piperidin-1-yl]methanone.
| Compound Name | [(1R,8S)-4-chloro-1-tetracyclo[6.6.1.02,7.09,14]pentadeca-2(7),3,5,9,11,13-hexaenyl]-[4-(pyridin-3-ylmethyl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 67637424 |
| Molecular Formula | C27H25ClN2O |
| Molecular Weight | 428.96 g/mol |
| Exact Mass | 428.17 |
| IUPAC Name | [(1R,8S)-4-chloro-1-tetracyclo[6.6.1.02,7.09,14]pentadeca-2(7),3,5,9,11,13-hexaenyl]-[4-(pyridin-3-ylmethyl)piperidin-1-yl]methanone |
| SMILES | O=C(N1CCC(Cc2cccnc2)CC1)[C@]12C[C@@H](c3ccccc31)c1ccc(Cl)cc12 |
| InChI | InChI=1S/C27H25ClN2O/c28-20-7-8-22-23-16-27(25(22)15-20,24-6-2-1-5-21(23)24)26(31)30-12-9-18(10-13-30)14-19-4-3-11-29-17-19/h1-8,11,15,17-18,23H,9-10,12-14,16H2/t23-,27+/m0/s1 |
| InChIKey | AIUVEVBEWUIUCG-WNCULLNHSA-N |
| XLogP | 5.35 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.96 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |