C22H16F4N2O3S — CID 67637793
N-(difluoromethyl)-4-[4-[2-(2,6-difluorophenyl)-4,5-dihydro-1,3-oxazol-4-yl]phenyl]benzenesulfonamide (PubChem CID 67637793) has the molecular formula C22H16F4N2O3S and a molecular weight of 464.44 g/mol. Its IUPAC name is N-(difluoromethyl)-4-[4-[2-(2,6-difluorophenyl)-4,5-dihydro-1,3-oxazol-4-yl]phenyl]benzenesulfonamide.
| Compound Name | N-(difluoromethyl)-4-[4-[2-(2,6-difluorophenyl)-4,5-dihydro-1,3-oxazol-4-yl]phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 67637793 |
| Molecular Formula | C22H16F4N2O3S |
| Molecular Weight | 464.44 g/mol |
| Exact Mass | 464.08 |
| IUPAC Name | N-(difluoromethyl)-4-[4-[2-(2,6-difluorophenyl)-4,5-dihydro-1,3-oxazol-4-yl]phenyl]benzenesulfonamide |
| SMILES | O=S(=O)(NC(F)F)c1ccc(-c2ccc(C3COC(c4c(F)cccc4F)=N3)cc2)cc1 |
| InChI | InChI=1S/C22H16F4N2O3S/c23-17-2-1-3-18(24)20(17)21-27-19(12-31-21)15-6-4-13(5-7-15)14-8-10-16(11-9-14)32(29,30)28-22(25)26/h1-11,19,22,28H,12H2 |
| InChIKey | CKOBNJLEFKQGCD-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.44 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|