C35H46O6SSi — CID 67637834
trimethyl-[(2S,3R,4S,6S)-2-methyl-6-[(2S,3R,4S,6S)-2-methyl-4-phenylmethoxy-6-phenylsulfanyloxan-3-yl]oxy-4-phenylmethoxyoxan-3-yl]oxysilane (PubChem CID 67637834) has the molecular formula C35H46O6SSi and a molecular weight of 622.90 g/mol. Its IUPAC name is trimethyl-[(2S,3R,4S,6S)-2-methyl-6-[(2S,3R,4S,6S)-2-methyl-4-phenylmethoxy-6-phenylsulfanyloxan-3-yl]oxy-4-phenylmethoxyoxan-3-yl]oxysilane.
| Compound Name | trimethyl-[(2S,3R,4S,6S)-2-methyl-6-[(2S,3R,4S,6S)-2-methyl-4-phenylmethoxy-6-phenylsulfanyloxan-3-yl]oxy-4-phenylmethoxyoxan-3-yl]oxysilane |
|---|---|
| PubChem CID | 67637834 |
| Molecular Formula | C35H46O6SSi |
| Molecular Weight | 622.90 g/mol |
| Exact Mass | 622.28 |
| IUPAC Name | trimethyl-[(2S,3R,4S,6S)-2-methyl-6-[(2S,3R,4S,6S)-2-methyl-4-phenylmethoxy-6-phenylsulfanyloxan-3-yl]oxy-4-phenylmethoxyoxan-3-yl]oxysilane |
| SMILES | C[C@@H]1O[C@@H](O[C@@H]2[C@H](C)O[C@@H](Sc3ccccc3)C[C@@H]2OCc2ccccc2)C[C@H](OCc2ccccc2)[C@@H]1O[Si](C)(C)C |
| InChI | InChI=1S/C35H46O6SSi/c1-25-34(31(37-24-28-17-11-7-12-18-28)22-33(39-25)42-29-19-13-8-14-20-29)40-32-21-30(36-23-27-15-9-6-10-16-27)35(26(2)38-32)41-43(3,4)5/h6-20,25-26,30-35H,21-24H2,1-5H3/t25-,26-,30-,31-,32-,33-,34+,35+/m0/s1 |
| InChIKey | MAGHITKDBJSSAE-YRDZFULSSA-N |
| XLogP | 7.82 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.90 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|