About oxalic acid;(3R,4S)-3-[(3-phenoxyphenoxy)methyl]-4-phenylpiperidine
oxalic acid;(3R,4S)-3-[(3-phenoxyphenoxy)methyl]-4-phenylpiperidine (PubChem CID 67638077) has the molecular formula C26H27NO6
and a molecular weight of 449.50 g/mol. Its IUPAC name is oxalic acid;(3R,4S)-3-[(3-phenoxyphenoxy)methyl]-4-phenylpiperidine.
Molecular Properties
| Compound Name | oxalic acid;(3R,4S)-3-[(3-phenoxyphenoxy)methyl]-4-phenylpiperidine |
| PubChem CID | 67638077 |
| Molecular Formula | C26H27NO6 |
| Molecular Weight | 449.50 g/mol |
| Exact Mass | 449.18 |
| IUPAC Name | oxalic acid;(3R,4S)-3-[(3-phenoxyphenoxy)methyl]-4-phenylpiperidine |
| SMILES | O=C(O)C(=O)O.c1ccc(Oc2cccc(OC[C@H]3CNCC[C@@H]3c3ccccc3)c2)cc1 |
| InChI | InChI=1S/C24H25NO2.C2H2O4/c1-3-8-19(9-4-1)24-14-15-25-17-20(24)18-26-22-12-7-13-23(16-22)27-21-10-5-2-6-11-21;3-1(4)2(5)6/h1-13,16,20,24-25H,14-15,17-18H2;(H,3,4)(H,5,6)/t20-,24-;/m1./s1 |
| InChIKey | MXQLXPCHESCEMU-OSMGBBKRSA-N |
| XLogP | 4.41 |
| TPSA | 105.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 449.50 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze oxalic acid;(3R,4S)-3-[(3-phenoxyphenoxy)methyl]-4-phenylpiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxalic acid;(3R,4S)-3-[(3-phenoxyphenoxy)methyl]-4-phenylpiperidine?
The IUPAC name of oxalic acid;(3R,4S)-3-[(3-phenoxyphenoxy)methyl]-4-phenylpiperidine (CID 67638077) is oxalic acid;(3R,4S)-3-[(3-phenoxyphenoxy)methyl]-4-phenylpiperidine.
What is the SMILES notation for oxalic acid;(3R,4S)-3-[(3-phenoxyphenoxy)methyl]-4-phenylpiperidine?
The canonical SMILES for oxalic acid;(3R,4S)-3-[(3-phenoxyphenoxy)methyl]-4-phenylpiperidine is O=C(O)C(=O)O.c1ccc(Oc2cccc(OC[C@H]3CNCC[C@@H]3c3ccccc3)c2)cc1.
What is the InChIKey of oxalic acid;(3R,4S)-3-[(3-phenoxyphenoxy)methyl]-4-phenylpiperidine?
The InChIKey is MXQLXPCHESCEMU-OSMGBBKRSA-N. The full InChI is InChI=1S/C24H25NO2.C2H2O4/c1-3-8-19(9-4-1)24-14-15-25-17-20(24)18-26-22-12-7-13-23(16-22)27-21-10-5-2-6-11-21;3-1(4)2(5)6/h1-13,16,20,24-25H,14-15,17-18H2;(H,3,4)(H,5,6)/t20-,24-;/m1./s1.
What are the key properties of oxalic acid;(3R,4S)-3-[(3-phenoxyphenoxy)methyl]-4-phenylpiperidine?
oxalic acid;(3R,4S)-3-[(3-phenoxyphenoxy)methyl]-4-phenylpiperidine has a molecular weight of 449.50 g/mol, XLogP of 4.41, 6 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for oxalic acid;(3R,4S)-3-[(3-phenoxyphenoxy)methyl]-4-phenylpiperidine is sourced from PubChem (CID 67638077), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).