C25H39N3O — CID 67638227
1-(2-cyclohexyl-2-methylcyclohexyl)-3-(4-piperidin-1-ylphenyl)urea (PubChem CID 67638227) has the molecular formula C25H39N3O and a molecular weight of 397.61 g/mol. Its IUPAC name is 1-(2-cyclohexyl-2-methylcyclohexyl)-3-(4-piperidin-1-ylphenyl)urea.
| Compound Name | 1-(2-cyclohexyl-2-methylcyclohexyl)-3-(4-piperidin-1-ylphenyl)urea |
|---|---|
| PubChem CID | 67638227 |
| Molecular Formula | C25H39N3O |
| Molecular Weight | 397.61 g/mol |
| Exact Mass | 397.31 |
| IUPAC Name | 1-(2-cyclohexyl-2-methylcyclohexyl)-3-(4-piperidin-1-ylphenyl)urea |
| SMILES | CC1(C2CCCCC2)CCCCC1NC(=O)Nc1ccc(N2CCCCC2)cc1 |
| InChI | InChI=1S/C25H39N3O/c1-25(20-10-4-2-5-11-20)17-7-6-12-23(25)27-24(29)26-21-13-15-22(16-14-21)28-18-8-3-9-19-28/h13-16,20,23H,2-12,17-19H2,1H3,(H2,26,27,29) |
| InChIKey | ATUSFPAXLIDYTA-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.61 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|