About (4-nitro-1H-pyrrol-2-yl) 3H-benzimidazole-5-carboxylate
(4-nitro-1H-pyrrol-2-yl) 3H-benzimidazole-5-carboxylate (PubChem CID 67638416) has the molecular formula C12H8N4O4
and a molecular weight of 272.22 g/mol. Its IUPAC name is (4-nitro-1H-pyrrol-2-yl) 3H-benzimidazole-5-carboxylate.
Molecular Properties
| Compound Name | (4-nitro-1H-pyrrol-2-yl) 3H-benzimidazole-5-carboxylate |
| PubChem CID | 67638416 |
| Molecular Formula | C12H8N4O4 |
| Molecular Weight | 272.22 g/mol |
| Exact Mass | 272.05 |
| IUPAC Name | (4-nitro-1H-pyrrol-2-yl) 3H-benzimidazole-5-carboxylate |
| SMILES | O=C(Oc1cc([N+](=O)[O-])c[nH]1)c1ccc2nc[nH]c2c1 |
| InChI | InChI=1S/C12H8N4O4/c17-12(20-11-4-8(5-13-11)16(18)19)7-1-2-9-10(3-7)15-6-14-9/h1-6,13H,(H,14,15) |
| InChIKey | VZVNJVSXXVCBBW-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 113.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.22 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (4-nitro-1H-pyrrol-2-yl) 3H-benzimidazole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-nitro-1H-pyrrol-2-yl) 3H-benzimidazole-5-carboxylate?
The IUPAC name of (4-nitro-1H-pyrrol-2-yl) 3H-benzimidazole-5-carboxylate (CID 67638416) is (4-nitro-1H-pyrrol-2-yl) 3H-benzimidazole-5-carboxylate.
What is the SMILES notation for (4-nitro-1H-pyrrol-2-yl) 3H-benzimidazole-5-carboxylate?
The canonical SMILES for (4-nitro-1H-pyrrol-2-yl) 3H-benzimidazole-5-carboxylate is O=C(Oc1cc([N+](=O)[O-])c[nH]1)c1ccc2nc[nH]c2c1.
What is the InChIKey of (4-nitro-1H-pyrrol-2-yl) 3H-benzimidazole-5-carboxylate?
The InChIKey is VZVNJVSXXVCBBW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8N4O4/c17-12(20-11-4-8(5-13-11)16(18)19)7-1-2-9-10(3-7)15-6-14-9/h1-6,13H,(H,14,15).
What are the key properties of (4-nitro-1H-pyrrol-2-yl) 3H-benzimidazole-5-carboxylate?
(4-nitro-1H-pyrrol-2-yl) 3H-benzimidazole-5-carboxylate has a molecular weight of 272.22 g/mol, XLogP of 2.02, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4-nitro-1H-pyrrol-2-yl) 3H-benzimidazole-5-carboxylate is sourced from PubChem (CID 67638416), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).