C40H58N4O3Si — CID 67638710
8-amino-6-ethyl-9-tri(propan-2-yl)silyl-5,6,7,8-tetrahydrocarbazole-3-carboxylic acid;1-[6-(ethylamino)-6,7,8,9-tetrahydro-5H-carbazol-3-yl]ethanone (PubChem CID 67638710) has the molecular formula C40H58N4O3Si and a molecular weight of 671.02 g/mol. Its IUPAC name is 8-amino-6-ethyl-9-tri(propan-2-yl)silyl-5,6,7,8-tetrahydrocarbazole-3-carboxylic acid;1-[6-(ethylamino)-6,7,8,9-tetrahydro-5H-carbazol-3-yl]ethanone.
| Compound Name | 8-amino-6-ethyl-9-tri(propan-2-yl)silyl-5,6,7,8-tetrahydrocarbazole-3-carboxylic acid;1-[6-(ethylamino)-6,7,8,9-tetrahydro-5H-carbazol-3-yl]ethanone |
|---|---|
| PubChem CID | 67638710 |
| Molecular Formula | C40H58N4O3Si |
| Molecular Weight | 671.02 g/mol |
| Exact Mass | 670.43 |
| IUPAC Name | 8-amino-6-ethyl-9-tri(propan-2-yl)silyl-5,6,7,8-tetrahydrocarbazole-3-carboxylic acid;1-[6-(ethylamino)-6,7,8,9-tetrahydro-5H-carbazol-3-yl]ethanone |
| SMILES | CCC1Cc2c(n([Si](C(C)C)(C(C)C)C(C)C)c3ccc(C(=O)O)cc23)C(N)C1.CCNC1CCc2[nH]c3ccc(C(C)=O)cc3c2C1 |
| InChI | InChI=1S/C24H38N2O2Si.C16H20N2O/c1-8-17-11-20-19-13-18(24(27)28)9-10-22(19)26(23(20)21(25)12-17)29(14(2)3,15(4)5)16(6)7;1-3-17-12-5-7-16-14(9-12)13-8-11(10(2)19)4-6-15(13)18-16/h9-10,13-17,21H,8,11-12,25H2,1-7H3,(H,27,28);4,6,8,12,17-18H,3,5,7,9H2,1-2H3 |
| InChIKey | KBYDRVGMTRFQMV-UHFFFAOYSA-N |
| XLogP | 9.17 |
| TPSA | 113.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.02 |
| LogP ≤ 5 | 9.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|