C18H24O3 — CID 67640352
2,2-dimethoxypropane;1,2,3,4-tetrahydrofluoren-9-one (PubChem CID 67640352) has the molecular formula C18H24O3 and a molecular weight of 288.39 g/mol. Its IUPAC name is 2,2-dimethoxypropane;1,2,3,4-tetrahydrofluoren-9-one.
| Compound Name | 2,2-dimethoxypropane;1,2,3,4-tetrahydrofluoren-9-one |
|---|---|
| PubChem CID | 67640352 |
| Molecular Formula | C18H24O3 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.17 |
| IUPAC Name | 2,2-dimethoxypropane;1,2,3,4-tetrahydrofluoren-9-one |
| SMILES | COC(C)(C)OC.O=C1C2=C(CCCC2)c2ccccc21 |
| InChI | InChI=1S/C13H12O.C5H12O2/c14-13-11-7-3-1-5-9(11)10-6-2-4-8-12(10)13;1-5(2,6-3)7-4/h1,3,5,7H,2,4,6,8H2;1-4H3 |
| InChIKey | WDNURUFHZCJHIB-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|