C23H35N3O4 — CID 67640382
5-[2-[2-(5,6-dimethoxy-1,2,3,4-tetrahydronaphthalen-2-yl)-2-hexylhydrazinyl]ethyl]-1,2-oxazol-3-one (PubChem CID 67640382) has the molecular formula C23H35N3O4 and a molecular weight of 417.55 g/mol. Its IUPAC name is 5-[2-[2-(5,6-dimethoxy-1,2,3,4-tetrahydronaphthalen-2-yl)-2-hexylhydrazinyl]ethyl]-1,2-oxazol-3-one.
| Compound Name | 5-[2-[2-(5,6-dimethoxy-1,2,3,4-tetrahydronaphthalen-2-yl)-2-hexylhydrazinyl]ethyl]-1,2-oxazol-3-one |
|---|---|
| PubChem CID | 67640382 |
| Molecular Formula | C23H35N3O4 |
| Molecular Weight | 417.55 g/mol |
| Exact Mass | 417.26 |
| IUPAC Name | 5-[2-[2-(5,6-dimethoxy-1,2,3,4-tetrahydronaphthalen-2-yl)-2-hexylhydrazinyl]ethyl]-1,2-oxazol-3-one |
| SMILES | CCCCCCN(NCCc1cc(=O)[nH]o1)C1CCc2c(ccc(OC)c2OC)C1 |
| InChI | InChI=1S/C23H35N3O4/c1-4-5-6-7-14-26(24-13-12-19-16-22(27)25-30-19)18-9-10-20-17(15-18)8-11-21(28-2)23(20)29-3/h8,11,16,18,24H,4-7,9-10,12-15H2,1-3H3,(H,25,27) |
| InChIKey | MJWFBUWWQQBXNY-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 79.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.55 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|