C41H64N2O4S — CID 67640714
2-[(2R,5R)-5-decyl-4-methyl-1,3-dioxan-2-yl]-6-[4-[(2R,5R)-5-decyl-4-methyl-1,3-dioxan-2-yl]phenyl]imidazo[2,1-b][1,3]thiazole (PubChem CID 67640714) has the molecular formula C41H64N2O4S and a molecular weight of 681.04 g/mol. Its IUPAC name is 2-[(2R,5R)-5-decyl-4-methyl-1,3-dioxan-2-yl]-6-[4-[(2R,5R)-5-decyl-4-methyl-1,3-dioxan-2-yl]phenyl]imidazo[2,1-b][1,3]thiazole.
| Compound Name | 2-[(2R,5R)-5-decyl-4-methyl-1,3-dioxan-2-yl]-6-[4-[(2R,5R)-5-decyl-4-methyl-1,3-dioxan-2-yl]phenyl]imidazo[2,1-b][1,3]thiazole |
|---|---|
| PubChem CID | 67640714 |
| Molecular Formula | C41H64N2O4S |
| Molecular Weight | 681.04 g/mol |
| Exact Mass | 680.46 |
| IUPAC Name | 2-[(2R,5R)-5-decyl-4-methyl-1,3-dioxan-2-yl]-6-[4-[(2R,5R)-5-decyl-4-methyl-1,3-dioxan-2-yl]phenyl]imidazo[2,1-b][1,3]thiazole |
| SMILES | CCCCCCCCCC[C@@H]1CO[C@@H](c2ccc(-c3cn4cc([C@@H]5OC[C@@H](CCCCCCCCCC)C(C)O5)sc4n3)cc2)OC1C |
| InChI | InChI=1S/C41H64N2O4S/c1-5-7-9-11-13-15-17-19-21-35-29-44-39(46-31(35)3)34-25-23-33(24-26-34)37-27-43-28-38(48-41(43)42-37)40-45-30-36(32(4)47-40)22-20-18-16-14-12-10-8-6-2/h23-28,31-32,35-36,39-40H,5-22,29-30H2,1-4H3/t31?,32?,35-,36-,39-,40-/m1/s1 |
| InChIKey | BMAJDCSCOPLLHN-SJLSMQCISA-N |
| XLogP | 12.22 |
| TPSA | 54.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.04 |
| LogP ≤ 5 | 12.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|