C5H8N2O2 — CID 676415
(5R)-5-methyl-1,3-diazinane-2,4-dione (PubChem CID 676415) has the molecular formula C5H8N2O2 and a molecular weight of 128.13 g/mol. Its IUPAC name is (5R)-5-methyl-1,3-diazinane-2,4-dione.
| Compound Name | (5R)-5-methyl-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 676415 |
| Molecular Formula | C5H8N2O2 |
| Molecular Weight | 128.13 g/mol |
| Exact Mass | 128.06 |
| IUPAC Name | (5R)-5-methyl-1,3-diazinane-2,4-dione |
| SMILES | C[C@@H]1CNC(=O)NC1=O |
| InChI | InChI=1S/C5H8N2O2/c1-3-2-6-5(9)7-4(3)8/h3H,2H2,1H3,(H2,6,7,8,9)/t3-/m1/s1 |
| InChIKey | NBAKTGXDIBVZOO-GSVOUGTGSA-N |
| XLogP | -0.54 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 128.13 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |