About (Z)-18-(2,5-dioxopyrrolidin-1-yl)octadec-9-enoic acid
(Z)-18-(2,5-dioxopyrrolidin-1-yl)octadec-9-enoic acid (PubChem CID 67641524) has the molecular formula C22H37NO4
and a molecular weight of 379.54 g/mol. Its IUPAC name is (Z)-18-(2,5-dioxopyrrolidin-1-yl)octadec-9-enoic acid.
Molecular Properties
| Compound Name | (Z)-18-(2,5-dioxopyrrolidin-1-yl)octadec-9-enoic acid |
| PubChem CID | 67641524 |
| Molecular Formula | C22H37NO4 |
| Molecular Weight | 379.54 g/mol |
| Exact Mass | 379.27 |
| IUPAC Name | (Z)-18-(2,5-dioxopyrrolidin-1-yl)octadec-9-enoic acid |
| SMILES | O=C(O)CCCCCCC/C=C\CCCCCCCCN1C(=O)CCC1=O |
| InChI | InChI=1S/C22H37NO4/c24-20-17-18-21(25)23(20)19-15-13-11-9-7-5-3-1-2-4-6-8-10-12-14-16-22(26)27/h1-2H,3-19H2,(H,26,27)/b2-1- |
| InChIKey | WNDRGQMZOCVSEY-UPHRSURJSA-N |
| XLogP | 5.24 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 379.54 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze (Z)-18-(2,5-dioxopyrrolidin-1-yl)octadec-9-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-18-(2,5-dioxopyrrolidin-1-yl)octadec-9-enoic acid?
The IUPAC name of (Z)-18-(2,5-dioxopyrrolidin-1-yl)octadec-9-enoic acid (CID 67641524) is (Z)-18-(2,5-dioxopyrrolidin-1-yl)octadec-9-enoic acid.
What is the SMILES notation for (Z)-18-(2,5-dioxopyrrolidin-1-yl)octadec-9-enoic acid?
The canonical SMILES for (Z)-18-(2,5-dioxopyrrolidin-1-yl)octadec-9-enoic acid is O=C(O)CCCCCCC/C=C\CCCCCCCCN1C(=O)CCC1=O.
What is the InChIKey of (Z)-18-(2,5-dioxopyrrolidin-1-yl)octadec-9-enoic acid?
The InChIKey is WNDRGQMZOCVSEY-UPHRSURJSA-N. The full InChI is InChI=1S/C22H37NO4/c24-20-17-18-21(25)23(20)19-15-13-11-9-7-5-3-1-2-4-6-8-10-12-14-16-22(26)27/h1-2H,3-19H2,(H,26,27)/b2-1-.
What are the key properties of (Z)-18-(2,5-dioxopyrrolidin-1-yl)octadec-9-enoic acid?
(Z)-18-(2,5-dioxopyrrolidin-1-yl)octadec-9-enoic acid has a molecular weight of 379.54 g/mol, XLogP of 5.24, 17 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-18-(2,5-dioxopyrrolidin-1-yl)octadec-9-enoic acid is sourced from PubChem (CID 67641524), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).