C10H9N2O5P — CID 67641592
[(E)-2-(2,3-dioxo-1,4-dihydroquinoxalin-5-yl)ethenyl]phosphonic acid (PubChem CID 67641592) has the molecular formula C10H9N2O5P and a molecular weight of 268.16 g/mol. Its IUPAC name is [(E)-2-(2,3-dioxo-1,4-dihydroquinoxalin-5-yl)ethenyl]phosphonic acid.
| Compound Name | [(E)-2-(2,3-dioxo-1,4-dihydroquinoxalin-5-yl)ethenyl]phosphonic acid |
|---|---|
| PubChem CID | 67641592 |
| Molecular Formula | C10H9N2O5P |
| Molecular Weight | 268.16 g/mol |
| Exact Mass | 268.02 |
| IUPAC Name | [(E)-2-(2,3-dioxo-1,4-dihydroquinoxalin-5-yl)ethenyl]phosphonic acid |
| SMILES | O=c1[nH]c2cccc(/C=C/P(=O)(O)O)c2[nH]c1=O |
| InChI | InChI=1S/C10H9N2O5P/c13-9-10(14)12-8-6(4-5-18(15,16)17)2-1-3-7(8)11-9/h1-5H,(H,11,13)(H,12,14)(H2,15,16,17)/b5-4+ |
| InChIKey | BABPOUFHWOCNNS-SNAWJCMRSA-N |
| XLogP | 0.36 |
| TPSA | 123.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.16 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|