C15H25NO4 — CID 67641746
(3R,4R,5R,6R)-1,4,5-tris(prop-2-enyl)azepane-3,4,5,6-tetrol (PubChem CID 67641746) has the molecular formula C15H25NO4 and a molecular weight of 283.37 g/mol. Its IUPAC name is (3R,4R,5R,6R)-1,4,5-tris(prop-2-enyl)azepane-3,4,5,6-tetrol.
| Compound Name | (3R,4R,5R,6R)-1,4,5-tris(prop-2-enyl)azepane-3,4,5,6-tetrol |
|---|---|
| PubChem CID | 67641746 |
| Molecular Formula | C15H25NO4 |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.18 |
| IUPAC Name | (3R,4R,5R,6R)-1,4,5-tris(prop-2-enyl)azepane-3,4,5,6-tetrol |
| SMILES | C=CCN1C[C@@H](O)[C@](O)(CC=C)[C@@](O)(CC=C)[C@H](O)C1 |
| InChI | InChI=1S/C15H25NO4/c1-4-7-14(19)12(17)10-16(9-6-3)11-13(18)15(14,20)8-5-2/h4-6,12-13,17-20H,1-3,7-11H2/t12-,13-,14-,15-/m1/s1 |
| InChIKey | GYURXRRBNNVVEE-KBUPBQIOSA-N |
| XLogP | -0.18 |
| TPSA | 84.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|