About 5-amino-3-[(2,3-dichlorophenyl)methyl]-6-(trifluoromethyl)-1H-pyrimidine-2,4-dione
5-amino-3-[(2,3-dichlorophenyl)methyl]-6-(trifluoromethyl)-1H-pyrimidine-2,4-dione (PubChem CID 67641815) has the molecular formula C12H8Cl2F3N3O2
and a molecular weight of 354.12 g/mol. Its IUPAC name is 5-amino-3-[(2,3-dichlorophenyl)methyl]-6-(trifluoromethyl)-1H-pyrimidine-2,4-dione.
Molecular Properties
| Compound Name | 5-amino-3-[(2,3-dichlorophenyl)methyl]-6-(trifluoromethyl)-1H-pyrimidine-2,4-dione |
| PubChem CID | 67641815 |
| Molecular Formula | C12H8Cl2F3N3O2 |
| Molecular Weight | 354.12 g/mol |
| Exact Mass | 352.99 |
| IUPAC Name | 5-amino-3-[(2,3-dichlorophenyl)methyl]-6-(trifluoromethyl)-1H-pyrimidine-2,4-dione |
| SMILES | Nc1c(C(F)(F)F)[nH]c(=O)n(Cc2cccc(Cl)c2Cl)c1=O |
| InChI | InChI=1S/C12H8Cl2F3N3O2/c13-6-3-1-2-5(7(6)14)4-20-10(21)8(18)9(12(15,16)17)19-11(20)22/h1-3H,4,18H2,(H,19,22) |
| InChIKey | OHADWPOQEQLNPS-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 80.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.12 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-amino-3-[(2,3-dichlorophenyl)methyl]-6-(trifluoromethyl)-1H-pyrimidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-3-[(2,3-dichlorophenyl)methyl]-6-(trifluoromethyl)-1H-pyrimidine-2,4-dione?
The IUPAC name of 5-amino-3-[(2,3-dichlorophenyl)methyl]-6-(trifluoromethyl)-1H-pyrimidine-2,4-dione (CID 67641815) is 5-amino-3-[(2,3-dichlorophenyl)methyl]-6-(trifluoromethyl)-1H-pyrimidine-2,4-dione.
What is the SMILES notation for 5-amino-3-[(2,3-dichlorophenyl)methyl]-6-(trifluoromethyl)-1H-pyrimidine-2,4-dione?
The canonical SMILES for 5-amino-3-[(2,3-dichlorophenyl)methyl]-6-(trifluoromethyl)-1H-pyrimidine-2,4-dione is Nc1c(C(F)(F)F)[nH]c(=O)n(Cc2cccc(Cl)c2Cl)c1=O.
What is the InChIKey of 5-amino-3-[(2,3-dichlorophenyl)methyl]-6-(trifluoromethyl)-1H-pyrimidine-2,4-dione?
The InChIKey is OHADWPOQEQLNPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8Cl2F3N3O2/c13-6-3-1-2-5(7(6)14)4-20-10(21)8(18)9(12(15,16)17)19-11(20)22/h1-3H,4,18H2,(H,19,22).
What are the key properties of 5-amino-3-[(2,3-dichlorophenyl)methyl]-6-(trifluoromethyl)-1H-pyrimidine-2,4-dione?
5-amino-3-[(2,3-dichlorophenyl)methyl]-6-(trifluoromethyl)-1H-pyrimidine-2,4-dione has a molecular weight of 354.12 g/mol, XLogP of 2.49, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-3-[(2,3-dichlorophenyl)methyl]-6-(trifluoromethyl)-1H-pyrimidine-2,4-dione is sourced from PubChem (CID 67641815), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).