About 10H-anthracen-9-one;fluoren-9-one
10H-anthracen-9-one;fluoren-9-one (PubChem CID 67642372) has the molecular formula C27H18O2
and a molecular weight of 374.44 g/mol. Its IUPAC name is 10H-anthracen-9-one;fluoren-9-one.
Molecular Properties
| Compound Name | 10H-anthracen-9-one;fluoren-9-one |
| PubChem CID | 67642372 |
| Molecular Formula | C27H18O2 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.13 |
| IUPAC Name | 10H-anthracen-9-one;fluoren-9-one |
| SMILES | O=C1c2ccccc2-c2ccccc21.O=C1c2ccccc2Cc2ccccc21 |
| InChI | InChI=1S/C14H10O.C13H8O/c15-14-12-7-3-1-5-10(12)9-11-6-2-4-8-13(11)14;14-13-11-7-3-1-5-9(11)10-6-2-4-8-12(10)13/h1-8H,9H2;1-8H |
| InChIKey | GUMKTNUPJYRIOG-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 10H-anthracen-9-one;fluoren-9-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10H-anthracen-9-one;fluoren-9-one?
The IUPAC name of 10H-anthracen-9-one;fluoren-9-one (CID 67642372) is 10H-anthracen-9-one;fluoren-9-one.
What is the SMILES notation for 10H-anthracen-9-one;fluoren-9-one?
The canonical SMILES for 10H-anthracen-9-one;fluoren-9-one is O=C1c2ccccc2-c2ccccc21.O=C1c2ccccc2Cc2ccccc21.
What is the InChIKey of 10H-anthracen-9-one;fluoren-9-one?
The InChIKey is GUMKTNUPJYRIOG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10O.C13H8O/c15-14-12-7-3-1-5-10(12)9-11-6-2-4-8-13(11)14;14-13-11-7-3-1-5-9(11)10-6-2-4-8-12(10)13/h1-8H,9H2;1-8H.
What are the key properties of 10H-anthracen-9-one;fluoren-9-one?
10H-anthracen-9-one;fluoren-9-one has a molecular weight of 374.44 g/mol, XLogP of 5.72, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 10H-anthracen-9-one;fluoren-9-one is sourced from PubChem (CID 67642372), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).