C21H20O5 — CID 67642398
7-O-benzyl 3-O-ethyl 8-methyl-2H-chromene-3,7-dicarboxylate (PubChem CID 67642398) has the molecular formula C21H20O5 and a molecular weight of 352.39 g/mol. Its IUPAC name is 7-O-benzyl 3-O-ethyl 8-methyl-2H-chromene-3,7-dicarboxylate.
| Compound Name | 7-O-benzyl 3-O-ethyl 8-methyl-2H-chromene-3,7-dicarboxylate |
|---|---|
| PubChem CID | 67642398 |
| Molecular Formula | C21H20O5 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.13 |
| IUPAC Name | 7-O-benzyl 3-O-ethyl 8-methyl-2H-chromene-3,7-dicarboxylate |
| SMILES | CCOC(=O)C1=Cc2ccc(C(=O)OCc3ccccc3)c(C)c2OC1 |
| InChI | InChI=1S/C21H20O5/c1-3-24-20(22)17-11-16-9-10-18(14(2)19(16)25-13-17)21(23)26-12-15-7-5-4-6-8-15/h4-11H,3,12-13H2,1-2H3 |
| InChIKey | VIGLONNAUBIZGU-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |