About [(2R,3R,5S)-3-fluoro-5-(1-hydroxy-2-oxo-2-phenylethyl)oxolan-2-yl] hypobromite
[(2R,3R,5S)-3-fluoro-5-(1-hydroxy-2-oxo-2-phenylethyl)oxolan-2-yl] hypobromite (PubChem CID 67642422) has the molecular formula C12H12BrFO4
and a molecular weight of 319.13 g/mol. Its IUPAC name is [(2R,3R,5S)-3-fluoro-5-(1-hydroxy-2-oxo-2-phenylethyl)oxolan-2-yl] hypobromite.
Molecular Properties
| Compound Name | [(2R,3R,5S)-3-fluoro-5-(1-hydroxy-2-oxo-2-phenylethyl)oxolan-2-yl] hypobromite |
| PubChem CID | 67642422 |
| Molecular Formula | C12H12BrFO4 |
| Molecular Weight | 319.13 g/mol |
| Exact Mass | 317.99 |
| IUPAC Name | [(2R,3R,5S)-3-fluoro-5-(1-hydroxy-2-oxo-2-phenylethyl)oxolan-2-yl] hypobromite |
| SMILES | O=C(c1ccccc1)C(O)[C@@H]1C[C@@H](F)[C@@H](OBr)O1 |
| InChI | InChI=1S/C12H12BrFO4/c13-18-12-8(14)6-9(17-12)11(16)10(15)7-4-2-1-3-5-7/h1-5,8-9,11-12,16H,6H2/t8-,9+,11?,12-/m1/s1 |
| InChIKey | PPQRIDLONRXRCJ-WSYXDHJASA-N |
| XLogP | 2.01 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.13 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [(2R,3R,5S)-3-fluoro-5-(1-hydroxy-2-oxo-2-phenylethyl)oxolan-2-yl] hypobromite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R,3R,5S)-3-fluoro-5-(1-hydroxy-2-oxo-2-phenylethyl)oxolan-2-yl] hypobromite?
The IUPAC name of [(2R,3R,5S)-3-fluoro-5-(1-hydroxy-2-oxo-2-phenylethyl)oxolan-2-yl] hypobromite (CID 67642422) is [(2R,3R,5S)-3-fluoro-5-(1-hydroxy-2-oxo-2-phenylethyl)oxolan-2-yl] hypobromite.
What is the SMILES notation for [(2R,3R,5S)-3-fluoro-5-(1-hydroxy-2-oxo-2-phenylethyl)oxolan-2-yl] hypobromite?
The canonical SMILES for [(2R,3R,5S)-3-fluoro-5-(1-hydroxy-2-oxo-2-phenylethyl)oxolan-2-yl] hypobromite is O=C(c1ccccc1)C(O)[C@@H]1C[C@@H](F)[C@@H](OBr)O1.
What is the InChIKey of [(2R,3R,5S)-3-fluoro-5-(1-hydroxy-2-oxo-2-phenylethyl)oxolan-2-yl] hypobromite?
The InChIKey is PPQRIDLONRXRCJ-WSYXDHJASA-N. The full InChI is InChI=1S/C12H12BrFO4/c13-18-12-8(14)6-9(17-12)11(16)10(15)7-4-2-1-3-5-7/h1-5,8-9,11-12,16H,6H2/t8-,9+,11?,12-/m1/s1.
What are the key properties of [(2R,3R,5S)-3-fluoro-5-(1-hydroxy-2-oxo-2-phenylethyl)oxolan-2-yl] hypobromite?
[(2R,3R,5S)-3-fluoro-5-(1-hydroxy-2-oxo-2-phenylethyl)oxolan-2-yl] hypobromite has a molecular weight of 319.13 g/mol, XLogP of 2.01, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R,3R,5S)-3-fluoro-5-(1-hydroxy-2-oxo-2-phenylethyl)oxolan-2-yl] hypobromite is sourced from PubChem (CID 67642422), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).