C30H40O6 — CID 67642562
5-[4-[4-[(2R)-6-hydroxy-2,5,7,8-tetramethyl-3,4-dihydrochromen-2-yl]but-3-enoxy]phenoxy]-2,2-dimethylpentanoic acid (PubChem CID 67642562) has the molecular formula C30H40O6 and a molecular weight of 496.64 g/mol. Its IUPAC name is 5-[4-[4-[(2R)-6-hydroxy-2,5,7,8-tetramethyl-3,4-dihydrochromen-2-yl]but-3-enoxy]phenoxy]-2,2-dimethylpentanoic acid.
| Compound Name | 5-[4-[4-[(2R)-6-hydroxy-2,5,7,8-tetramethyl-3,4-dihydrochromen-2-yl]but-3-enoxy]phenoxy]-2,2-dimethylpentanoic acid |
|---|---|
| PubChem CID | 67642562 |
| Molecular Formula | C30H40O6 |
| Molecular Weight | 496.64 g/mol |
| Exact Mass | 496.28 |
| IUPAC Name | 5-[4-[4-[(2R)-6-hydroxy-2,5,7,8-tetramethyl-3,4-dihydrochromen-2-yl]but-3-enoxy]phenoxy]-2,2-dimethylpentanoic acid |
| SMILES | Cc1c(C)c2c(c(C)c1O)CC[C@](C)(C=CCCOc1ccc(OCCCC(C)(C)C(=O)O)cc1)O2 |
| InChI | InChI=1S/C30H40O6/c1-20-21(2)27-25(22(3)26(20)31)14-17-30(6,36-27)16-7-8-18-34-23-10-12-24(13-11-23)35-19-9-15-29(4,5)28(32)33/h7,10-13,16,31H,8-9,14-15,17-19H2,1-6H3,(H,32,33)/t30-/m0/s1 |
| InChIKey | ZMJHOJOEKHAEKS-PMERELPUSA-N |
| XLogP | 6.70 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.64 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|