C27H27N3O4S3 — CID 67642794
1,1-dioxo-4-[(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)methylidene]-2,6-bis(2-thiophen-2-ylethyl)-1,2,6-thiadiazinane-3,5-dione (PubChem CID 67642794) has the molecular formula C27H27N3O4S3 and a molecular weight of 553.73 g/mol. Its IUPAC name is 1,1-dioxo-4-[(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)methylidene]-2,6-bis(2-thiophen-2-ylethyl)-1,2,6-thiadiazinane-3,5-dione.
| Compound Name | 1,1-dioxo-4-[(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)methylidene]-2,6-bis(2-thiophen-2-ylethyl)-1,2,6-thiadiazinane-3,5-dione |
|---|---|
| PubChem CID | 67642794 |
| Molecular Formula | C27H27N3O4S3 |
| Molecular Weight | 553.73 g/mol |
| Exact Mass | 553.12 |
| IUPAC Name | 1,1-dioxo-4-[(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)methylidene]-2,6-bis(2-thiophen-2-ylethyl)-1,2,6-thiadiazinane-3,5-dione |
| SMILES | O=C1C(=CN2CC=C(c3ccccc3)CC2)C(=O)N(CCc2cccs2)S(=O)(=O)N1CCc1cccs1 |
| InChI | InChI=1S/C27H27N3O4S3/c31-26-25(20-28-14-10-22(11-15-28)21-6-2-1-3-7-21)27(32)30(17-13-24-9-5-19-36-24)37(33,34)29(26)16-12-23-8-4-18-35-23/h1-10,18-20H,11-17H2 |
| InChIKey | OBFVMQXGPDHCQO-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 78.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.73 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|