About N-ethyl-4,6-difluoropyrimidin-2-amine
N-ethyl-4,6-difluoropyrimidin-2-amine (PubChem CID 676431) has the molecular formula C6H7F2N3
and a molecular weight of 159.14 g/mol. Its IUPAC name is N-ethyl-4,6-difluoropyrimidin-2-amine.
Molecular Properties
| Compound Name | N-ethyl-4,6-difluoropyrimidin-2-amine |
| PubChem CID | 676431 |
| Molecular Formula | C6H7F2N3 |
| Molecular Weight | 159.14 g/mol |
| Exact Mass | 159.06 |
| IUPAC Name | N-ethyl-4,6-difluoropyrimidin-2-amine |
| SMILES | CCNc1nc(F)cc(F)n1 |
| InChI | InChI=1S/C6H7F2N3/c1-2-9-6-10-4(7)3-5(8)11-6/h3H,2H2,1H3,(H,9,10,11) |
| InChIKey | NLIZQOOOXXYIOT-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.14 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-ethyl-4,6-difluoropyrimidin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-4,6-difluoropyrimidin-2-amine?
The IUPAC name of N-ethyl-4,6-difluoropyrimidin-2-amine (CID 676431) is N-ethyl-4,6-difluoropyrimidin-2-amine.
What is the SMILES notation for N-ethyl-4,6-difluoropyrimidin-2-amine?
The canonical SMILES for N-ethyl-4,6-difluoropyrimidin-2-amine is CCNc1nc(F)cc(F)n1.
What is the InChIKey of N-ethyl-4,6-difluoropyrimidin-2-amine?
The InChIKey is NLIZQOOOXXYIOT-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7F2N3/c1-2-9-6-10-4(7)3-5(8)11-6/h3H,2H2,1H3,(H,9,10,11).
What are the key properties of N-ethyl-4,6-difluoropyrimidin-2-amine?
N-ethyl-4,6-difluoropyrimidin-2-amine has a molecular weight of 159.14 g/mol, XLogP of 1.19, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-4,6-difluoropyrimidin-2-amine is sourced from PubChem (CID 676431), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).