About 6-fluoro-2-N,4-N-dimethylpyrimidine-2,4-diamine
6-fluoro-2-N,4-N-dimethylpyrimidine-2,4-diamine (PubChem CID 676433) has the molecular formula C6H9FN4
and a molecular weight of 156.16 g/mol. Its IUPAC name is 6-fluoro-2-N,4-N-dimethylpyrimidine-2,4-diamine.
Molecular Properties
| Compound Name | 6-fluoro-2-N,4-N-dimethylpyrimidine-2,4-diamine |
| PubChem CID | 676433 |
| Molecular Formula | C6H9FN4 |
| Molecular Weight | 156.16 g/mol |
| Exact Mass | 156.08 |
| IUPAC Name | 6-fluoro-2-N,4-N-dimethylpyrimidine-2,4-diamine |
| SMILES | CNc1cc(F)nc(NC)n1 |
| InChI | InChI=1S/C6H9FN4/c1-8-5-3-4(7)10-6(9-2)11-5/h3H,1-2H3,(H2,8,9,10,11) |
| InChIKey | AQILNHQSSMIBAW-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.16 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-fluoro-2-N,4-N-dimethylpyrimidine-2,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-fluoro-2-N,4-N-dimethylpyrimidine-2,4-diamine?
The IUPAC name of 6-fluoro-2-N,4-N-dimethylpyrimidine-2,4-diamine (CID 676433) is 6-fluoro-2-N,4-N-dimethylpyrimidine-2,4-diamine.
What is the SMILES notation for 6-fluoro-2-N,4-N-dimethylpyrimidine-2,4-diamine?
The canonical SMILES for 6-fluoro-2-N,4-N-dimethylpyrimidine-2,4-diamine is CNc1cc(F)nc(NC)n1.
What is the InChIKey of 6-fluoro-2-N,4-N-dimethylpyrimidine-2,4-diamine?
The InChIKey is AQILNHQSSMIBAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9FN4/c1-8-5-3-4(7)10-6(9-2)11-5/h3H,1-2H3,(H2,8,9,10,11).
What are the key properties of 6-fluoro-2-N,4-N-dimethylpyrimidine-2,4-diamine?
6-fluoro-2-N,4-N-dimethylpyrimidine-2,4-diamine has a molecular weight of 156.16 g/mol, XLogP of 0.70, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-fluoro-2-N,4-N-dimethylpyrimidine-2,4-diamine is sourced from PubChem (CID 676433), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).