About oxo-bis[3-(1H-1,2,4-triazol-5-yl)propoxy]phosphanium
oxo-bis[3-(1H-1,2,4-triazol-5-yl)propoxy]phosphanium (PubChem CID 67643334) has the molecular formula C10H16N6O3P+
and a molecular weight of 299.25 g/mol. Its IUPAC name is oxo-bis[3-(1H-1,2,4-triazol-5-yl)propoxy]phosphanium.
Molecular Properties
| Compound Name | oxo-bis[3-(1H-1,2,4-triazol-5-yl)propoxy]phosphanium |
| PubChem CID | 67643334 |
| Molecular Formula | C10H16N6O3P+ |
| Molecular Weight | 299.25 g/mol |
| Exact Mass | 299.10 |
| IUPAC Name | oxo-bis[3-(1H-1,2,4-triazol-5-yl)propoxy]phosphanium |
| SMILES | O=[P+](OCCCc1ncn[nH]1)OCCCc1ncn[nH]1 |
| InChI | InChI=1S/C10H16N6O3P/c17-20(18-5-1-3-9-11-7-13-15-9)19-6-2-4-10-12-8-14-16-10/h7-8H,1-6H2,(H,11,13,15)(H,12,14,16)/q+1 |
| InChIKey | HJZQSLCFEAYUPE-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 118.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.25 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze oxo-bis[3-(1H-1,2,4-triazol-5-yl)propoxy]phosphanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxo-bis[3-(1H-1,2,4-triazol-5-yl)propoxy]phosphanium?
The IUPAC name of oxo-bis[3-(1H-1,2,4-triazol-5-yl)propoxy]phosphanium (CID 67643334) is oxo-bis[3-(1H-1,2,4-triazol-5-yl)propoxy]phosphanium.
What is the SMILES notation for oxo-bis[3-(1H-1,2,4-triazol-5-yl)propoxy]phosphanium?
The canonical SMILES for oxo-bis[3-(1H-1,2,4-triazol-5-yl)propoxy]phosphanium is O=[P+](OCCCc1ncn[nH]1)OCCCc1ncn[nH]1.
What is the InChIKey of oxo-bis[3-(1H-1,2,4-triazol-5-yl)propoxy]phosphanium?
The InChIKey is HJZQSLCFEAYUPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N6O3P/c17-20(18-5-1-3-9-11-7-13-15-9)19-6-2-4-10-12-8-14-16-10/h7-8H,1-6H2,(H,11,13,15)(H,12,14,16)/q+1.
What are the key properties of oxo-bis[3-(1H-1,2,4-triazol-5-yl)propoxy]phosphanium?
oxo-bis[3-(1H-1,2,4-triazol-5-yl)propoxy]phosphanium has a molecular weight of 299.25 g/mol, XLogP of 1.18, 10 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for oxo-bis[3-(1H-1,2,4-triazol-5-yl)propoxy]phosphanium is sourced from PubChem (CID 67643334), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).