About 1-(1,3,5-triazin-2-yl)ethene-1,2-diamine
1-(1,3,5-triazin-2-yl)ethene-1,2-diamine (PubChem CID 67643771) has the molecular formula C5H7N5
and a molecular weight of 137.15 g/mol. Its IUPAC name is 1-(1,3,5-triazin-2-yl)ethene-1,2-diamine.
Molecular Properties
| Compound Name | 1-(1,3,5-triazin-2-yl)ethene-1,2-diamine |
| PubChem CID | 67643771 |
| Molecular Formula | C5H7N5 |
| Molecular Weight | 137.15 g/mol |
| Exact Mass | 137.07 |
| IUPAC Name | 1-(1,3,5-triazin-2-yl)ethene-1,2-diamine |
| SMILES | NC=C(N)c1ncncn1 |
| InChI | InChI=1S/C5H7N5/c6-1-4(7)5-9-2-8-3-10-5/h1-3H,6-7H2 |
| InChIKey | JWTHNVSYSCUHIX-UHFFFAOYSA-N |
| XLogP | -0.91 |
| TPSA | 90.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 137.15 |
| LogP ≤ 5 | -0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-(1,3,5-triazin-2-yl)ethene-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1,3,5-triazin-2-yl)ethene-1,2-diamine?
The IUPAC name of 1-(1,3,5-triazin-2-yl)ethene-1,2-diamine (CID 67643771) is 1-(1,3,5-triazin-2-yl)ethene-1,2-diamine.
What is the SMILES notation for 1-(1,3,5-triazin-2-yl)ethene-1,2-diamine?
The canonical SMILES for 1-(1,3,5-triazin-2-yl)ethene-1,2-diamine is NC=C(N)c1ncncn1.
What is the InChIKey of 1-(1,3,5-triazin-2-yl)ethene-1,2-diamine?
The InChIKey is JWTHNVSYSCUHIX-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7N5/c6-1-4(7)5-9-2-8-3-10-5/h1-3H,6-7H2.
What are the key properties of 1-(1,3,5-triazin-2-yl)ethene-1,2-diamine?
1-(1,3,5-triazin-2-yl)ethene-1,2-diamine has a molecular weight of 137.15 g/mol, XLogP of -0.91, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1,3,5-triazin-2-yl)ethene-1,2-diamine is sourced from PubChem (CID 67643771), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).