C6H10N2O2 — CID 676438
(3R,6S)-3,6-dimethylpiperazine-2,5-dione (PubChem CID 676438) has the molecular formula C6H10N2O2 and a molecular weight of 142.16 g/mol. Its IUPAC name is (3R,6S)-3,6-dimethylpiperazine-2,5-dione.
| Compound Name | (3R,6S)-3,6-dimethylpiperazine-2,5-dione |
|---|---|
| PubChem CID | 676438 |
| Molecular Formula | C6H10N2O2 |
| Molecular Weight | 142.16 g/mol |
| Exact Mass | 142.07 |
| IUPAC Name | (3R,6S)-3,6-dimethylpiperazine-2,5-dione |
| SMILES | C[C@@H]1NC(=O)[C@@H](C)NC1=O |
| InChI | InChI=1S/C6H10N2O2/c1-3-5(9)8-4(2)6(10)7-3/h3-4H,1-2H3,(H,7,10)(H,8,9)/t3-,4+ |
| InChIKey | WWISPHBAYBECQZ-ZXZARUISSA-N |
| XLogP | -0.99 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.16 |
| LogP ≤ 5 | -0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |