About 2-(hydroxymethyl)anthracene-9,10-dione;4-(2-methylprop-2-enoylamino)butanoic acid
2-(hydroxymethyl)anthracene-9,10-dione;4-(2-methylprop-2-enoylamino)butanoic acid (PubChem CID 67643996) has the molecular formula C23H23NO6
and a molecular weight of 409.44 g/mol. Its IUPAC name is 2-(hydroxymethyl)anthracene-9,10-dione;4-(2-methylprop-2-enoylamino)butanoic acid.
Molecular Properties
| Compound Name | 2-(hydroxymethyl)anthracene-9,10-dione;4-(2-methylprop-2-enoylamino)butanoic acid |
| PubChem CID | 67643996 |
| Molecular Formula | C23H23NO6 |
| Molecular Weight | 409.44 g/mol |
| Exact Mass | 409.15 |
| IUPAC Name | 2-(hydroxymethyl)anthracene-9,10-dione;4-(2-methylprop-2-enoylamino)butanoic acid |
| SMILES | C=C(C)C(=O)NCCCC(=O)O.O=C1c2ccccc2C(=O)c2cc(CO)ccc21 |
| InChI | InChI=1S/C15H10O3.C8H13NO3/c16-8-9-5-6-12-13(7-9)15(18)11-4-2-1-3-10(11)14(12)17;1-6(2)8(12)9-5-3-4-7(10)11/h1-7,16H,8H2;1,3-5H2,2H3,(H,9,12)(H,10,11) |
| InChIKey | NFFROHJPEDZWND-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 120.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 409.44 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(hydroxymethyl)anthracene-9,10-dione;4-(2-methylprop-2-enoylamino)butanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(hydroxymethyl)anthracene-9,10-dione;4-(2-methylprop-2-enoylamino)butanoic acid?
The IUPAC name of 2-(hydroxymethyl)anthracene-9,10-dione;4-(2-methylprop-2-enoylamino)butanoic acid (CID 67643996) is 2-(hydroxymethyl)anthracene-9,10-dione;4-(2-methylprop-2-enoylamino)butanoic acid.
What is the SMILES notation for 2-(hydroxymethyl)anthracene-9,10-dione;4-(2-methylprop-2-enoylamino)butanoic acid?
The canonical SMILES for 2-(hydroxymethyl)anthracene-9,10-dione;4-(2-methylprop-2-enoylamino)butanoic acid is C=C(C)C(=O)NCCCC(=O)O.O=C1c2ccccc2C(=O)c2cc(CO)ccc21.
What is the InChIKey of 2-(hydroxymethyl)anthracene-9,10-dione;4-(2-methylprop-2-enoylamino)butanoic acid?
The InChIKey is NFFROHJPEDZWND-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H10O3.C8H13NO3/c16-8-9-5-6-12-13(7-9)15(18)11-4-2-1-3-10(11)14(12)17;1-6(2)8(12)9-5-3-4-7(10)11/h1-7,16H,8H2;1,3-5H2,2H3,(H,9,12)(H,10,11).
What are the key properties of 2-(hydroxymethyl)anthracene-9,10-dione;4-(2-methylprop-2-enoylamino)butanoic acid?
2-(hydroxymethyl)anthracene-9,10-dione;4-(2-methylprop-2-enoylamino)butanoic acid has a molecular weight of 409.44 g/mol, XLogP of 2.50, 6 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(hydroxymethyl)anthracene-9,10-dione;4-(2-methylprop-2-enoylamino)butanoic acid is sourced from PubChem (CID 67643996), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).