C16H13NO6 — CID 67644186
4,5,6,7-tetraacetylisoindole-1,3-dione (PubChem CID 67644186) has the molecular formula C16H13NO6 and a molecular weight of 315.28 g/mol. Its IUPAC name is 4,5,6,7-tetraacetylisoindole-1,3-dione.
| Compound Name | 4,5,6,7-tetraacetylisoindole-1,3-dione |
|---|---|
| PubChem CID | 67644186 |
| Molecular Formula | C16H13NO6 |
| Molecular Weight | 315.28 g/mol |
| Exact Mass | 315.07 |
| IUPAC Name | 4,5,6,7-tetraacetylisoindole-1,3-dione |
| SMILES | CC(=O)c1c(C(C)=O)c(C(C)=O)c2c(c1C(C)=O)C(=O)NC2=O |
| InChI | InChI=1S/C16H13NO6/c1-5(18)9-10(6(2)19)12(8(4)21)14-13(11(9)7(3)20)15(22)17-16(14)23/h1-4H3,(H,17,22,23) |
| InChIKey | XCSKRJJKEVHFFF-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 114.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.28 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|