C23H45N3 — CID 67644241
1-(2-octadec-9-enyl-4,5-dihydro-1H-imidazol-5-yl)ethanamine (PubChem CID 67644241) has the molecular formula C23H45N3 and a molecular weight of 363.63 g/mol. Its IUPAC name is 1-(2-octadec-9-enyl-4,5-dihydro-1H-imidazol-5-yl)ethanamine.
| Compound Name | 1-(2-octadec-9-enyl-4,5-dihydro-1H-imidazol-5-yl)ethanamine |
|---|---|
| PubChem CID | 67644241 |
| Molecular Formula | C23H45N3 |
| Molecular Weight | 363.63 g/mol |
| Exact Mass | 363.36 |
| IUPAC Name | 1-(2-octadec-9-enyl-4,5-dihydro-1H-imidazol-5-yl)ethanamine |
| SMILES | CCCCCCCCC=CCCCCCCCCC1=NCC(C(C)N)N1 |
| InChI | InChI=1S/C23H45N3/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-23-25-20-22(26-23)21(2)24/h10-11,21-22H,3-9,12-20,24H2,1-2H3,(H,25,26) |
| InChIKey | PIJFFEQMTJDKQS-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.63 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|