(4R)-2,2-dimethyl-1,3-thiazolidine-4-carboxylic acid

C6H11NO2S — CID 676443

IUPAC(4R)-2,2-dimethyl-1,3-thiazolidine-4-carboxylic acid
SMILESCC1(C)N[C@H](C(=O)O)CS1
InChIInChI=1S/C6H11NO2S/c1-6(2)7-4(3-10-6)5(8)9/h4,7H,3H2,1-2H3,(H,8,9)/t4-/m0/s1
InChIKeyOCQICQZUUHJWGZ-BYPYZUCNSA-N
MW161.23 g/mol
LogP0.51
Rot. Bonds1

About (4R)-2,2-dimethyl-1,3-thiazolidine-4-carboxylic acid

(4R)-2,2-dimethyl-1,3-thiazolidine-4-carboxylic acid (PubChem CID 676443) has the molecular formula C6H11NO2S and a molecular weight of 161.23 g/mol. Its IUPAC name is (4R)-2,2-dimethyl-1,3-thiazolidine-4-carboxylic acid.

Molecular Properties

Compound Name(4R)-2,2-dimethyl-1,3-thiazolidine-4-carboxylic acid
PubChem CID676443
Molecular FormulaC6H11NO2S
Molecular Weight161.23 g/mol
Exact Mass161.05
IUPAC Name(4R)-2,2-dimethyl-1,3-thiazolidine-4-carboxylic acid
SMILESCC1(C)N[C@H](C(=O)O)CS1
InChIInChI=1S/C6H11NO2S/c1-6(2)7-4(3-10-6)5(8)9/h4,7H,3H2,1-2H3,(H,8,9)/t4-/m0/s1
InChIKeyOCQICQZUUHJWGZ-BYPYZUCNSA-N
XLogP0.51
TPSA49.33 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms10
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500161.23
LogP ≤ 50.51
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze (4R)-2,2-dimethyl-1,3-thiazolidine-4-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (4R)-2,2-dimethyl-1,3-thiazolidine-4-carboxylic acid?
The IUPAC name of (4R)-2,2-dimethyl-1,3-thiazolidine-4-carboxylic acid (CID 676443) is (4R)-2,2-dimethyl-1,3-thiazolidine-4-carboxylic acid.
What is the SMILES notation for (4R)-2,2-dimethyl-1,3-thiazolidine-4-carboxylic acid?
The canonical SMILES for (4R)-2,2-dimethyl-1,3-thiazolidine-4-carboxylic acid is CC1(C)N[C@H](C(=O)O)CS1.
What is the InChIKey of (4R)-2,2-dimethyl-1,3-thiazolidine-4-carboxylic acid?
The InChIKey is OCQICQZUUHJWGZ-BYPYZUCNSA-N. The full InChI is InChI=1S/C6H11NO2S/c1-6(2)7-4(3-10-6)5(8)9/h4,7H,3H2,1-2H3,(H,8,9)/t4-/m0/s1.
What are the key properties of (4R)-2,2-dimethyl-1,3-thiazolidine-4-carboxylic acid?
(4R)-2,2-dimethyl-1,3-thiazolidine-4-carboxylic acid has a molecular weight of 161.23 g/mol, XLogP of 0.51, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-2,2-dimethyl-1,3-thiazolidine-4-carboxylic acid is sourced from PubChem (CID 676443), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).