About 1-(4,5-dihydro-1H-imidazol-2-yl)-2-methylicos-11-en-1-amine
1-(4,5-dihydro-1H-imidazol-2-yl)-2-methylicos-11-en-1-amine (PubChem CID 67644457) has the molecular formula C24H47N3
and a molecular weight of 377.66 g/mol. Its IUPAC name is 1-(4,5-dihydro-1H-imidazol-2-yl)-2-methylicos-11-en-1-amine.
Molecular Properties
| Compound Name | 1-(4,5-dihydro-1H-imidazol-2-yl)-2-methylicos-11-en-1-amine |
| PubChem CID | 67644457 |
| Molecular Formula | C24H47N3 |
| Molecular Weight | 377.66 g/mol |
| Exact Mass | 377.38 |
| IUPAC Name | 1-(4,5-dihydro-1H-imidazol-2-yl)-2-methylicos-11-en-1-amine |
| SMILES | CCCCCCCCC=CCCCCCCCCC(C)C(N)C1=NCCN1 |
| InChI | InChI=1S/C24H47N3/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-22(2)23(25)24-26-20-21-27-24/h10-11,22-23H,3-9,12-21,25H2,1-2H3,(H,26,27) |
| InChIKey | UOSUQCAUGNKDTM-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 377.66 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-(4,5-dihydro-1H-imidazol-2-yl)-2-methylicos-11-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4,5-dihydro-1H-imidazol-2-yl)-2-methylicos-11-en-1-amine?
The IUPAC name of 1-(4,5-dihydro-1H-imidazol-2-yl)-2-methylicos-11-en-1-amine (CID 67644457) is 1-(4,5-dihydro-1H-imidazol-2-yl)-2-methylicos-11-en-1-amine.
What is the SMILES notation for 1-(4,5-dihydro-1H-imidazol-2-yl)-2-methylicos-11-en-1-amine?
The canonical SMILES for 1-(4,5-dihydro-1H-imidazol-2-yl)-2-methylicos-11-en-1-amine is CCCCCCCCC=CCCCCCCCCC(C)C(N)C1=NCCN1.
What is the InChIKey of 1-(4,5-dihydro-1H-imidazol-2-yl)-2-methylicos-11-en-1-amine?
The InChIKey is UOSUQCAUGNKDTM-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H47N3/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-22(2)23(25)24-26-20-21-27-24/h10-11,22-23H,3-9,12-21,25H2,1-2H3,(H,26,27).
What are the key properties of 1-(4,5-dihydro-1H-imidazol-2-yl)-2-methylicos-11-en-1-amine?
1-(4,5-dihydro-1H-imidazol-2-yl)-2-methylicos-11-en-1-amine has a molecular weight of 377.66 g/mol, XLogP of 6.38, 18 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4,5-dihydro-1H-imidazol-2-yl)-2-methylicos-11-en-1-amine is sourced from PubChem (CID 67644457), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).