C10H13FN3+ — CID 67644717
2-(3-fluorophenyl)-2,4-dimethyl-3H-1,2,4-triazol-2-ium (PubChem CID 67644717) has the molecular formula C10H13FN3+ and a molecular weight of 194.23 g/mol. Its IUPAC name is 2-(3-fluorophenyl)-2,4-dimethyl-3H-1,2,4-triazol-2-ium.
| Compound Name | 2-(3-fluorophenyl)-2,4-dimethyl-3H-1,2,4-triazol-2-ium |
|---|---|
| PubChem CID | 67644717 |
| Molecular Formula | C10H13FN3+ |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.11 |
| IUPAC Name | 2-(3-fluorophenyl)-2,4-dimethyl-3H-1,2,4-triazol-2-ium |
| SMILES | CN1C=N[N+](C)(c2cccc(F)c2)C1 |
| InChI | InChI=1S/C10H13FN3/c1-13-7-12-14(2,8-13)10-5-3-4-9(11)6-10/h3-7H,8H2,1-2H3/q+1 |
| InChIKey | CYGAYFJVZITDIG-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|