C32H29Cl2N3O4S — CID 67644727
2-chloro-N-[4-[7-chloro-2-methoxy-2-(2-pyridin-4-ylsulfanylethoxy)-4,5-dihydro-3H-1-benzazepine-1-carbonyl]phenyl]benzamide (PubChem CID 67644727) has the molecular formula C32H29Cl2N3O4S and a molecular weight of 622.57 g/mol. Its IUPAC name is 2-chloro-N-[4-[7-chloro-2-methoxy-2-(2-pyridin-4-ylsulfanylethoxy)-4,5-dihydro-3H-1-benzazepine-1-carbonyl]phenyl]benzamide.
| Compound Name | 2-chloro-N-[4-[7-chloro-2-methoxy-2-(2-pyridin-4-ylsulfanylethoxy)-4,5-dihydro-3H-1-benzazepine-1-carbonyl]phenyl]benzamide |
|---|---|
| PubChem CID | 67644727 |
| Molecular Formula | C32H29Cl2N3O4S |
| Molecular Weight | 622.57 g/mol |
| Exact Mass | 621.13 |
| IUPAC Name | 2-chloro-N-[4-[7-chloro-2-methoxy-2-(2-pyridin-4-ylsulfanylethoxy)-4,5-dihydro-3H-1-benzazepine-1-carbonyl]phenyl]benzamide |
| SMILES | COC1(OCCSc2ccncc2)CCCc2cc(Cl)ccc2N1C(=O)c1ccc(NC(=O)c2ccccc2Cl)cc1 |
| InChI | InChI=1S/C32H29Cl2N3O4S/c1-40-32(41-19-20-42-26-14-17-35-18-15-26)16-4-5-23-21-24(33)10-13-29(23)37(32)31(39)22-8-11-25(12-9-22)36-30(38)27-6-2-3-7-28(27)34/h2-3,6-15,17-18,21H,4-5,16,19-20H2,1H3,(H,36,38) |
| InChIKey | DUNSAUJGWPPKKB-UHFFFAOYSA-N |
| XLogP | 7.73 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.57 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|