About 1-O-[4-[(3-amino-2-pyridinyl)amino]phenyl] 3-O-tert-butyl 2-aminopropanedioate
1-O-[4-[(3-amino-2-pyridinyl)amino]phenyl] 3-O-tert-butyl 2-aminopropanedioate (PubChem CID 67644962) has the molecular formula C18H22N4O4
and a molecular weight of 358.40 g/mol. Its IUPAC name is 1-O-[4-[(3-amino-2-pyridinyl)amino]phenyl] 3-O-tert-butyl 2-aminopropanedioate.
Molecular Properties
| Compound Name | 1-O-[4-[(3-amino-2-pyridinyl)amino]phenyl] 3-O-tert-butyl 2-aminopropanedioate |
| PubChem CID | 67644962 |
| Molecular Formula | C18H22N4O4 |
| Molecular Weight | 358.40 g/mol |
| Exact Mass | 358.16 |
| IUPAC Name | 1-O-[4-[(3-amino-2-pyridinyl)amino]phenyl] 3-O-tert-butyl 2-aminopropanedioate |
| SMILES | CC(C)(C)OC(=O)C(N)C(=O)Oc1ccc(Nc2ncccc2N)cc1 |
| InChI | InChI=1S/C18H22N4O4/c1-18(2,3)26-17(24)14(20)16(23)25-12-8-6-11(7-9-12)22-15-13(19)5-4-10-21-15/h4-10,14H,19-20H2,1-3H3,(H,21,22) |
| InChIKey | NYFBITURMFSLHY-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 129.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.40 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze 1-O-[4-[(3-amino-2-pyridinyl)amino]phenyl] 3-O-tert-butyl 2-aminopropanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-O-[4-[(3-amino-2-pyridinyl)amino]phenyl] 3-O-tert-butyl 2-aminopropanedioate?
The IUPAC name of 1-O-[4-[(3-amino-2-pyridinyl)amino]phenyl] 3-O-tert-butyl 2-aminopropanedioate (CID 67644962) is 1-O-[4-[(3-amino-2-pyridinyl)amino]phenyl] 3-O-tert-butyl 2-aminopropanedioate.
What is the SMILES notation for 1-O-[4-[(3-amino-2-pyridinyl)amino]phenyl] 3-O-tert-butyl 2-aminopropanedioate?
The canonical SMILES for 1-O-[4-[(3-amino-2-pyridinyl)amino]phenyl] 3-O-tert-butyl 2-aminopropanedioate is CC(C)(C)OC(=O)C(N)C(=O)Oc1ccc(Nc2ncccc2N)cc1.
What is the InChIKey of 1-O-[4-[(3-amino-2-pyridinyl)amino]phenyl] 3-O-tert-butyl 2-aminopropanedioate?
The InChIKey is NYFBITURMFSLHY-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H22N4O4/c1-18(2,3)26-17(24)14(20)16(23)25-12-8-6-11(7-9-12)22-15-13(19)5-4-10-21-15/h4-10,14H,19-20H2,1-3H3,(H,21,22).
What are the key properties of 1-O-[4-[(3-amino-2-pyridinyl)amino]phenyl] 3-O-tert-butyl 2-aminopropanedioate?
1-O-[4-[(3-amino-2-pyridinyl)amino]phenyl] 3-O-tert-butyl 2-aminopropanedioate has a molecular weight of 358.40 g/mol, XLogP of 1.98, 5 rotatable bonds, 3 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 1-O-[4-[(3-amino-2-pyridinyl)amino]phenyl] 3-O-tert-butyl 2-aminopropanedioate is sourced from PubChem (CID 67644962), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).