C22H18FN3O2S — CID 67645019
N-[1-benzyl-4-(4-fluorophenyl)pyrazol-3-yl]benzenesulfonamide (PubChem CID 67645019) has the molecular formula C22H18FN3O2S and a molecular weight of 407.47 g/mol. Its IUPAC name is N-[1-benzyl-4-(4-fluorophenyl)pyrazol-3-yl]benzenesulfonamide.
| Compound Name | N-[1-benzyl-4-(4-fluorophenyl)pyrazol-3-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 67645019 |
| Molecular Formula | C22H18FN3O2S |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.11 |
| IUPAC Name | N-[1-benzyl-4-(4-fluorophenyl)pyrazol-3-yl]benzenesulfonamide |
| SMILES | O=S(=O)(Nc1nn(Cc2ccccc2)cc1-c1ccc(F)cc1)c1ccccc1 |
| InChI | InChI=1S/C22H18FN3O2S/c23-19-13-11-18(12-14-19)21-16-26(15-17-7-3-1-4-8-17)24-22(21)25-29(27,28)20-9-5-2-6-10-20/h1-14,16H,15H2,(H,24,25) |
| InChIKey | WAUFKNOWRBBWME-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |