About 4-(aminomethyl)-N-(N'-methylcarbamimidoyl)-1H-indole-2-carboxamide
4-(aminomethyl)-N-(N'-methylcarbamimidoyl)-1H-indole-2-carboxamide (PubChem CID 67645266) has the molecular formula C12H15N5O
and a molecular weight of 245.29 g/mol. Its IUPAC name is 4-(aminomethyl)-N-(N'-methylcarbamimidoyl)-1H-indole-2-carboxamide.
Molecular Properties
| Compound Name | 4-(aminomethyl)-N-(N'-methylcarbamimidoyl)-1H-indole-2-carboxamide |
| PubChem CID | 67645266 |
| Molecular Formula | C12H15N5O |
| Molecular Weight | 245.29 g/mol |
| Exact Mass | 245.13 |
| IUPAC Name | 4-(aminomethyl)-N-(N'-methylcarbamimidoyl)-1H-indole-2-carboxamide |
| SMILES | C/N=C(\N)NC(=O)c1cc2c(CN)cccc2[nH]1 |
| InChI | InChI=1S/C12H15N5O/c1-15-12(14)17-11(18)10-5-8-7(6-13)3-2-4-9(8)16-10/h2-5,16H,6,13H2,1H3,(H3,14,15,17,18) |
| InChIKey | DOLCXLFTAAXOAM-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 109.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.29 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 4-(aminomethyl)-N-(N'-methylcarbamimidoyl)-1H-indole-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(aminomethyl)-N-(N'-methylcarbamimidoyl)-1H-indole-2-carboxamide?
The IUPAC name of 4-(aminomethyl)-N-(N'-methylcarbamimidoyl)-1H-indole-2-carboxamide (CID 67645266) is 4-(aminomethyl)-N-(N'-methylcarbamimidoyl)-1H-indole-2-carboxamide.
What is the SMILES notation for 4-(aminomethyl)-N-(N'-methylcarbamimidoyl)-1H-indole-2-carboxamide?
The canonical SMILES for 4-(aminomethyl)-N-(N'-methylcarbamimidoyl)-1H-indole-2-carboxamide is C/N=C(\N)NC(=O)c1cc2c(CN)cccc2[nH]1.
What is the InChIKey of 4-(aminomethyl)-N-(N'-methylcarbamimidoyl)-1H-indole-2-carboxamide?
The InChIKey is DOLCXLFTAAXOAM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15N5O/c1-15-12(14)17-11(18)10-5-8-7(6-13)3-2-4-9(8)16-10/h2-5,16H,6,13H2,1H3,(H3,14,15,17,18).
What are the key properties of 4-(aminomethyl)-N-(N'-methylcarbamimidoyl)-1H-indole-2-carboxamide?
4-(aminomethyl)-N-(N'-methylcarbamimidoyl)-1H-indole-2-carboxamide has a molecular weight of 245.29 g/mol, XLogP of 0.30, 2 rotatable bonds, 4 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(aminomethyl)-N-(N'-methylcarbamimidoyl)-1H-indole-2-carboxamide is sourced from PubChem (CID 67645266), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).