About 1-(4,5-dihydro-1H-imidazol-2-yl)-2-ethylicos-11-en-1-amine
1-(4,5-dihydro-1H-imidazol-2-yl)-2-ethylicos-11-en-1-amine (PubChem CID 67645272) has the molecular formula C25H49N3
and a molecular weight of 391.69 g/mol. Its IUPAC name is 1-(4,5-dihydro-1H-imidazol-2-yl)-2-ethylicos-11-en-1-amine.
Molecular Properties
| Compound Name | 1-(4,5-dihydro-1H-imidazol-2-yl)-2-ethylicos-11-en-1-amine |
| PubChem CID | 67645272 |
| Molecular Formula | C25H49N3 |
| Molecular Weight | 391.69 g/mol |
| Exact Mass | 391.39 |
| IUPAC Name | 1-(4,5-dihydro-1H-imidazol-2-yl)-2-ethylicos-11-en-1-amine |
| SMILES | CCCCCCCCC=CCCCCCCCCC(CC)C(N)C1=NCCN1 |
| InChI | InChI=1S/C25H49N3/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-23(4-2)24(26)25-27-21-22-28-25/h11-12,23-24H,3-10,13-22,26H2,1-2H3,(H,27,28) |
| InChIKey | PEAMKNBAAMFKEI-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 391.69 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-(4,5-dihydro-1H-imidazol-2-yl)-2-ethylicos-11-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4,5-dihydro-1H-imidazol-2-yl)-2-ethylicos-11-en-1-amine?
The IUPAC name of 1-(4,5-dihydro-1H-imidazol-2-yl)-2-ethylicos-11-en-1-amine (CID 67645272) is 1-(4,5-dihydro-1H-imidazol-2-yl)-2-ethylicos-11-en-1-amine.
What is the SMILES notation for 1-(4,5-dihydro-1H-imidazol-2-yl)-2-ethylicos-11-en-1-amine?
The canonical SMILES for 1-(4,5-dihydro-1H-imidazol-2-yl)-2-ethylicos-11-en-1-amine is CCCCCCCCC=CCCCCCCCCC(CC)C(N)C1=NCCN1.
What is the InChIKey of 1-(4,5-dihydro-1H-imidazol-2-yl)-2-ethylicos-11-en-1-amine?
The InChIKey is PEAMKNBAAMFKEI-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H49N3/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-23(4-2)24(26)25-27-21-22-28-25/h11-12,23-24H,3-10,13-22,26H2,1-2H3,(H,27,28).
What are the key properties of 1-(4,5-dihydro-1H-imidazol-2-yl)-2-ethylicos-11-en-1-amine?
1-(4,5-dihydro-1H-imidazol-2-yl)-2-ethylicos-11-en-1-amine has a molecular weight of 391.69 g/mol, XLogP of 6.77, 19 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4,5-dihydro-1H-imidazol-2-yl)-2-ethylicos-11-en-1-amine is sourced from PubChem (CID 67645272), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).