About [4-benzoyloxy-3,6-dioxo-5-(2-prop-2-enyl-1H-indol-3-yl)cyclohexa-1,4-dien-1-yl] benzoate
[4-benzoyloxy-3,6-dioxo-5-(2-prop-2-enyl-1H-indol-3-yl)cyclohexa-1,4-dien-1-yl] benzoate (PubChem CID 67645379) has the molecular formula C31H21NO6
and a molecular weight of 503.51 g/mol. Its IUPAC name is [4-benzoyloxy-3,6-dioxo-5-(2-prop-2-enyl-1H-indol-3-yl)cyclohexa-1,4-dien-1-yl] benzoate.
Molecular Properties
| Compound Name | [4-benzoyloxy-3,6-dioxo-5-(2-prop-2-enyl-1H-indol-3-yl)cyclohexa-1,4-dien-1-yl] benzoate |
| PubChem CID | 67645379 |
| Molecular Formula | C31H21NO6 |
| Molecular Weight | 503.51 g/mol |
| Exact Mass | 503.14 |
| IUPAC Name | [4-benzoyloxy-3,6-dioxo-5-(2-prop-2-enyl-1H-indol-3-yl)cyclohexa-1,4-dien-1-yl] benzoate |
| SMILES | C=CCc1[nH]c2ccccc2c1C1=C(OC(=O)c2ccccc2)C(=O)C=C(OC(=O)c2ccccc2)C1=O |
| InChI | InChI=1S/C31H21NO6/c1-2-11-23-26(21-16-9-10-17-22(21)32-23)27-28(34)25(37-30(35)19-12-5-3-6-13-19)18-24(33)29(27)38-31(36)20-14-7-4-8-15-20/h2-10,12-18,32H,1,11H2 |
| InChIKey | MCOUEITZGCORMU-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 102.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 503.51 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [4-benzoyloxy-3,6-dioxo-5-(2-prop-2-enyl-1H-indol-3-yl)cyclohexa-1,4-dien-1-yl] benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-benzoyloxy-3,6-dioxo-5-(2-prop-2-enyl-1H-indol-3-yl)cyclohexa-1,4-dien-1-yl] benzoate?
The IUPAC name of [4-benzoyloxy-3,6-dioxo-5-(2-prop-2-enyl-1H-indol-3-yl)cyclohexa-1,4-dien-1-yl] benzoate (CID 67645379) is [4-benzoyloxy-3,6-dioxo-5-(2-prop-2-enyl-1H-indol-3-yl)cyclohexa-1,4-dien-1-yl] benzoate.
What is the SMILES notation for [4-benzoyloxy-3,6-dioxo-5-(2-prop-2-enyl-1H-indol-3-yl)cyclohexa-1,4-dien-1-yl] benzoate?
The canonical SMILES for [4-benzoyloxy-3,6-dioxo-5-(2-prop-2-enyl-1H-indol-3-yl)cyclohexa-1,4-dien-1-yl] benzoate is C=CCc1[nH]c2ccccc2c1C1=C(OC(=O)c2ccccc2)C(=O)C=C(OC(=O)c2ccccc2)C1=O.
What is the InChIKey of [4-benzoyloxy-3,6-dioxo-5-(2-prop-2-enyl-1H-indol-3-yl)cyclohexa-1,4-dien-1-yl] benzoate?
The InChIKey is MCOUEITZGCORMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C31H21NO6/c1-2-11-23-26(21-16-9-10-17-22(21)32-23)27-28(34)25(37-30(35)19-12-5-3-6-13-19)18-24(33)29(27)38-31(36)20-14-7-4-8-15-20/h2-10,12-18,32H,1,11H2.
What are the key properties of [4-benzoyloxy-3,6-dioxo-5-(2-prop-2-enyl-1H-indol-3-yl)cyclohexa-1,4-dien-1-yl] benzoate?
[4-benzoyloxy-3,6-dioxo-5-(2-prop-2-enyl-1H-indol-3-yl)cyclohexa-1,4-dien-1-yl] benzoate has a molecular weight of 503.51 g/mol, XLogP of 5.36, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [4-benzoyloxy-3,6-dioxo-5-(2-prop-2-enyl-1H-indol-3-yl)cyclohexa-1,4-dien-1-yl] benzoate is sourced from PubChem (CID 67645379), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).