About phenylthiourea
phenylthiourea (PubChem CID 676454) has the molecular formula C7H8N2S
and a molecular weight of 152.22 g/mol. Its IUPAC name is phenylthiourea.
Molecular Properties
| Compound Name | phenylthiourea |
| PubChem CID | 676454 |
| Molecular Formula | C7H8N2S |
| Molecular Weight | 152.22 g/mol |
| Exact Mass | 152.04 |
| IUPAC Name | phenylthiourea |
| SMILES | NC(=S)Nc1ccccc1 |
| InChI | InChI=1S/C7H8N2S/c8-7(10)9-6-4-2-1-3-5-6/h1-5H,(H3,8,9,10) |
| InChIKey | FULZLIGZKMKICU-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.22 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze phenylthiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenylthiourea?
The IUPAC name of phenylthiourea (CID 676454) is phenylthiourea.
What is the SMILES notation for phenylthiourea?
The canonical SMILES for phenylthiourea is NC(=S)Nc1ccccc1.
What is the InChIKey of phenylthiourea?
The InChIKey is FULZLIGZKMKICU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N2S/c8-7(10)9-6-4-2-1-3-5-6/h1-5H,(H3,8,9,10).
What are the key properties of phenylthiourea?
phenylthiourea has a molecular weight of 152.22 g/mol, XLogP of 1.34, 1 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for phenylthiourea is sourced from PubChem (CID 676454), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).