About CID 67645513
CID 67645513 (PubChem CID 67645513) has the molecular formula C19H31N2O3Si2
and a molecular weight of 391.64 g/mol.
Molecular Properties
| Compound Name | CID 67645513 |
| PubChem CID | 67645513 |
| Molecular Formula | C19H31N2O3Si2 |
| Molecular Weight | 391.64 g/mol |
| Exact Mass | 391.19 |
| IUPAC Name | — |
| SMILES | C[Si](C)OC(CC(C)(C)C)c1c([Si](C)(C)C)[nH]c2ccc([N+](=O)[O-])cc12 |
| InChI | InChI=1S/C19H31N2O3Si2/c1-19(2,3)12-16(24-25(4)5)17-14-11-13(21(22)23)9-10-15(14)20-18(17)26(6,7)8/h9-11,16,20H,12H2,1-8H3 |
| InChIKey | OFCZFWCXNJNHRR-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 68.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 391.64 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze CID 67645513 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 67645513?
The IUPAC name of CID 67645513 (CID 67645513) is not available.
What is the SMILES notation for CID 67645513?
The canonical SMILES for CID 67645513 is C[Si](C)OC(CC(C)(C)C)c1c([Si](C)(C)C)[nH]c2ccc([N+](=O)[O-])cc12.
What is the InChIKey of CID 67645513?
The InChIKey is OFCZFWCXNJNHRR-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H31N2O3Si2/c1-19(2,3)12-16(24-25(4)5)17-14-11-13(21(22)23)9-10-15(14)20-18(17)26(6,7)8/h9-11,16,20H,12H2,1-8H3.
What are the key properties of CID 67645513?
CID 67645513 has a molecular weight of 391.64 g/mol, XLogP of 5.37, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 67645513 is sourced from PubChem (CID 67645513), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).